missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1,1,3,3-Tetramethylbutyl Isocyanide 95.0+%, TCI America™
Supplier: TCI America T10545ML
Specifications
| 1,1,3,3-Tetramethylbutyl Isocyanide | |
| Colorless | |
| C9H17N | |
| 5 mL | |
| YVPXQMYCTGCWBE-UHFFFAOYSA-N | |
| 2-isocyano-2,4,4-trimethylpentane | |
| 26725 | |
| ≥95.0% (GC) |
| 14542-93-9 | |
| 50°C | |
| MFCD00000003 | |
| 1993 | |
| CC(C)(C)CC(C)(C)[N+]#[C-] | |
| 139.242 | |
| 139.24 | |
| Liquid |
Chemical Identifiers
| 14542-93-9 | |
| 139.242 | |
| YVPXQMYCTGCWBE-UHFFFAOYSA-N | |
| 2-isocyano-2,4,4-trimethylpentane |
| C9H17N | |
| MFCD00000003 | |
| 26725 | |
| CC(C)(C)CC(C)(C)[N+]#[C-] |
Safety and Handling
TSCA : Yes
Recommended Storage : Refrigerator