missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1,3-Bis(chloromethyl)tetramethyldisilazane 95.0+%, TCI America™
Supplier: TCI America B09905G
Specifications
| 1,3-Bis(chloromethyl)tetramethyldisilazane | |
| Yellow | |
| C6H17Cl2NSi2 | |
| 5 g | |
| Tetramethyl-1,3-bis(chloromethyl)disilazane | |
| C[Si](C)(CCl)N[Si](C)(C)CCl | |
| 230.279 | |
| 230.28 | |
| Liquid |
| 14579-91-0 | |
| 72°C | |
| MFCD00000876 | |
| 1760 | |
| SXSNZRHGAMVNJE-UHFFFAOYSA-N | |
| chloro-[[[chloromethyl(dimethyl)silyl]amino]-dimethylsilyl]methane | |
| 26740 | |
| ≥95.0% (GC) |
Chemical Identifiers
| 14579-91-0 | |
| 230.279 | |
| SXSNZRHGAMVNJE-UHFFFAOYSA-N | |
| 26740 | |
| C[Si](C)(CCl)N[Si](C)(C)CCl |
| C6H17Cl2NSi2 | |
| MFCD00000876 | |
| Tetramethyl-1,3-bis(chloromethyl)disilazane | |
| chloro-[[[chloromethyl(dimethyl)silyl]amino]-dimethylsilyl]methane |
Safety and Handling
RTECSNumber : JM9210000
TSCA : Yes