missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
![[1,4-Bis(diphenylphosphino)butane]palladium(II) Dichloride 96.0+%, TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/Chemical-Structures/chemical-structure-cas-29964-62-3.jpg-650.jpg)
![[1,4-Bis(diphenylphosphino)butane]palladium(II) Dichloride 96.0+%, TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/TCI-America/logos/Rings Blue.jpg-650.jpg)
[1,4-Bis(diphenylphosphino)butane]palladium(II) Dichloride 96.0+%, TCI America™
Supplier: TCI America B20315G
Specifications
| [1,4-Bis(diphenylphosphino)butane]palladium(II) Dichloride | |
| C28H28Cl2P2Pd | |
| 5 g | |
| JQXJBXVWVPVTOO-UHFFFAOYSA-L | |
| [4-(diphenylphosphanyl)butyl]diphenylphosphane; dichloropalladium | |
| 10974057 | |
| ≥96.0% (T) |
| 29964-62-3 | |
| MFCD02093437 | |
| 1,4-bis diphenylphosphino butane-palladium ii chloride, 1,4-butylenebis diphenylphosphine palladium dichloride, pdcl2 dppb, 1,4-bis diphenylphosphino butane palladium ii dichloride, palladium ii chloride-1,4-bis diphenylphosphine butane, dichloro bis 1,4-diphenylphosphino butane palladium ii, palladium ii chloride 1,4-bis diphenylphosphino butane complex, dichloro 1,4-bis diphenylphosphino butane palladium ii, pd dppb cl2, acmc-209sk1 | |
| Cl[Pd]Cl.C(CCP(C1=CC=CC=C1)C1=CC=CC=C1)CP(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 603.80 | |
| 603.80 | |
| Crystalline Powder |
Chemical Identifiers
| 29964-62-3 | |
| 603.80 | |
| JQXJBXVWVPVTOO-UHFFFAOYSA-L | |
| 10974057 | |
| Cl[Pd]Cl.C(CCP(C1=CC=CC=C1)C1=CC=CC=C1)CP(C1=CC=CC=C1)C1=CC=CC=C1 |
| C28H28Cl2P2Pd | |
| MFCD02093437 | |
| 1,4-bis diphenylphosphino butane-palladium ii chloride, 1,4-butylenebis diphenylphosphine palladium dichloride, pdcl2 dppb, 1,4-bis diphenylphosphino butane palladium ii dichloride, palladium ii chloride-1,4-bis diphenylphosphine butane, dichloro bis 1,4-diphenylphosphino butane palladium ii, palladium ii chloride 1,4-bis diphenylphosphino butane complex, dichloro 1,4-bis diphenylphosphino butane palladium ii, pd dppb cl2, acmc-209sk1 | |
| [4-(diphenylphosphanyl)butyl]diphenylphosphane; dichloropalladium |
Safety and Handling
TSCA : No