missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
![1-Acetoxy-2-methoxy-4-[(E)-1-propenyl]benzene 98.0+%, TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/Chemical-Structures/chemical-structure-cas-93-29-8.jpg-650.jpg)
![1-Acetoxy-2-methoxy-4-[(E)-1-propenyl]benzene 98.0+%, TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/TCI-America/logos/Rings Blue.jpg-650.jpg)
1-Acetoxy-2-methoxy-4-[(E)-1-propenyl]benzene 98.0+%, TCI America™
Supplier: TCI America A118425G
Specifications
| 1-Acetoxy-2-methoxy-4-(1-propenyl)benzene | |
| 81°C | |
| 283°C | |
| MFCD00026984 | |
| Acetylisoeugenol | |
| COC1=CC(\C=C\C)=CC=C1OC(C)=O | |
| 206.24 | |
| CHEBI:86583 | |
| ≥98.0% (GC) |
| 93-29-8 | |
| White-Yellow | |
| C12H14O3 | |
| 25 g | |
| IUSBVFZKQJGVEP-SNAWJCMRSA-N | |
| 2-methoxy-4-[(1E)-prop-1-en-1-yl]phenyl acetate | |
| 876160 | |
| 206.24 | |
| Crystalline Powder |
Chemical Identifiers
| 93-29-8 | |
| 206.24 | |
| IUSBVFZKQJGVEP-SNAWJCMRSA-N | |
| 876160 | |
| 2-methoxy-4-[(1E)-prop-1-en-1-yl]phenyl acetate |
| C12H14O3 | |
| MFCD00026984 | |
| Acetylisoeugenol | |
| CHEBI:86583 | |
| COC1=CC(\C=C\C)=CC=C1OC(C)=O |
Safety and Handling
RTECSNumber : SL7940000
TSCA : Yes