missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1-Hydroxycyclohexyl Phenyl Ketone 98.0+%, TCI America™
$77.03 - $519.43
Chemical Identifiers
| CAS | 947-19-3 |
|---|---|
| Molecular Formula | C13H16O2 |
| Molecular Weight (g/mol) | 204.269 |
| MDL Number | MFCD00059561 |
| InChI Key | QNODIIQQMGDSEF-UHFFFAOYSA-N |
| Synonym | 1-hydroxycyclohexyl phenyl ketone, 1-hydroxycyclohexyl phenyl methanone, 1-benzoylcyclohexanol, hydroxycyclohexyl phenyl ketone, 1-benzoylcyclohexan-1-ol, irgacure 184, methanone, 1-hydroxycyclohexyl phenyl, unii-e7jvn2243x, 1-hydroxycyclohexyl-phenylmethanone, 1-cyclohexylhydroxyphenylketone |
| PubChem CID | 70355 |
| IUPAC Name | (1-hydroxycyclohexyl)-phenylmethanone |
| SMILES | C1CCC(CC1)(C(=O)C2=CC=CC=C2)O |
Chemical Identifiers
| 947-19-3 | |
| 204.269 | |
| QNODIIQQMGDSEF-UHFFFAOYSA-N | |
| 70355 | |
| C1CCC(CC1)(C(=O)C2=CC=CC=C2)O |
| C13H16O2 | |
| MFCD00059561 | |
| 1-hydroxycyclohexyl phenyl ketone, 1-hydroxycyclohexyl phenyl methanone, 1-benzoylcyclohexanol, hydroxycyclohexyl phenyl ketone, 1-benzoylcyclohexan-1-ol, irgacure 184, methanone, 1-hydroxycyclohexyl phenyl, unii-e7jvn2243x, 1-hydroxycyclohexyl-phenylmethanone, 1-cyclohexylhydroxyphenylketone | |
| (1-hydroxycyclohexyl)-phenylmethanone |
Specifications
| 947-19-3 | |
| White-Yellow | |
| MFCD00059561 | |
| 1-hydroxycyclohexyl phenyl ketone, 1-hydroxycyclohexyl phenyl methanone, 1-benzoylcyclohexanol, hydroxycyclohexyl phenyl ketone, 1-benzoylcyclohexan-1-ol, irgacure 184, methanone, 1-hydroxycyclohexyl phenyl, unii-e7jvn2243x, 1-hydroxycyclohexyl-phenylmethanone, 1-cyclohexylhydroxyphenylketone | |
| C1CCC(CC1)(C(=O)C2=CC=CC=C2)O | |
| 204.269 | |
| 204.27 | |
| Crystalline Powder |
| 49°C | |
| C13H16O2 | |
| 25 g | |
| QNODIIQQMGDSEF-UHFFFAOYSA-N | |
| (1-hydroxycyclohexyl)-phenylmethanone | |
| 70355 | |
| ≥98.0% (GC) | |
| 1-Hydroxycyclohexyl Phenyl Ketone |
Safety and Handling
EINECSNumber : (4)-1397
TSCA : Yes