missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
1H,1H,2H,2H-Tridecafluoro-n-octyl Methacrylate (stabilized with HQ + MEHQ) 98.0+%, TCI America™
$144.33 - $933.02
Chemical Identifiers
| CAS | 2144-53-8 |
|---|---|
| Molecular Formula | C12H9F13O2 |
| Molecular Weight (g/mol) | 432.18 |
| MDL Number | MFCD00077580 |
| InChI Key | CDXFIRXEAJABAZ-UHFFFAOYSA-N |
| Synonym | Methacrylic Acid 1H,1H,2H,2H-Tridecafluoro-n-octyl Ester, 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-n-octyl Methacrylate, Methacrylic Acid 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-n-octyl Ester |
| PubChem CID | 75066 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl 2-methylprop-2-enoate |
| SMILES | CC(=C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
Chemical Identifiers
| 2144-53-8 | |
| 432.18 | |
| CDXFIRXEAJABAZ-UHFFFAOYSA-N | |
| 75066 | |
| CC(=C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| C12H9F13O2 | |
| MFCD00077580 | |
| Methacrylic Acid 1H,1H,2H,2H-Tridecafluoro-n-octyl Ester, 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-n-octyl Methacrylate, Methacrylic Acid 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-n-octyl Ester | |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl 2-methylprop-2-enoate |
Specifications
| 2144-53-8 | |
| C12H9F13O2 | |
| 5 g | |
| CDXFIRXEAJABAZ-UHFFFAOYSA-N | |
| 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl 2-methylprop-2-enoate | |
| 75066 | |
| ≥98.0% (GC) | |
| 1H,1H,2H,2H-Tridecafluoro-n-octyl Methacrylate (stabilized with HQ + MEHQ) |
| 92°C | |
| MFCD00077580 | |
| Methacrylic Acid 1H,1H,2H,2H-Tridecafluoro-n-octyl Ester, 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-n-octyl Methacrylate, Methacrylic Acid 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluoro-n-octyl Ester | |
| CC(=C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F | |
| 432.18 | |
| 432.18 | |
| Liquid |
Safety and Handling
EINECSNumber : (2)-3492&(2)-4065
RTECSNumber : UD3580000
TSCA : Yes