missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2,2,3,3,4,4-Hexafluoro-1,5-pentanediol 98.0+%, TCI America™
Supplier: TCI America H074625G
Specifications
| 2,2,3,3,4,4-Hexafluoro-1,5-pentanediol | |
| 79°C | |
| 112°C | |
| MFCD00042434 | |
| 2,2,3,3,4,4-hexafluoro-1,5-pentanediol, hexafluoroamylene glycol, 1,5-pentanediol, 2,2,3,3,4,4-hexafluoro, hexafluoro-1,5-pentanediol, 2,2,3,3,4,4-hexafluoropentanediol, 2,2,3,3,4,4-hexafluoropentan-1,5-diol, 1,5-dihydroxy-2,2,3,3,4,4-hexafluoropentane, acmc-209iuy, ielvmupswdzwsd-uhfffaoysa, 2,3,3,4,4-hexafluoropentanediol | |
| C(C(C(C(CO)(F)F)(F)F)(F)F)O | |
| 212.091 | |
| 212.09 | |
| Crystalline Powder |
| 376-90-9 | |
| White | |
| C5H6F6O2 | |
| 25 g | |
| IELVMUPSWDZWSD-UHFFFAOYSA-N | |
| 2,2,3,3,4,4-hexafluoropentane-1,5-diol | |
| 67831 | |
| ≥98.0% (GC) |
Chemical Identifiers
| 376-90-9 | |
| 212.091 | |
| IELVMUPSWDZWSD-UHFFFAOYSA-N | |
| 67831 | |
| C(C(C(C(CO)(F)F)(F)F)(F)F)O |
| C5H6F6O2 | |
| MFCD00042434 | |
| 2,2,3,3,4,4-hexafluoro-1,5-pentanediol, hexafluoroamylene glycol, 1,5-pentanediol, 2,2,3,3,4,4-hexafluoro, hexafluoro-1,5-pentanediol, 2,2,3,3,4,4-hexafluoropentanediol, 2,2,3,3,4,4-hexafluoropentan-1,5-diol, 1,5-dihydroxy-2,2,3,3,4,4-hexafluoropentane, acmc-209iuy, ielvmupswdzwsd-uhfffaoysa, 2,3,3,4,4-hexafluoropentanediol | |
| 2,2,3,3,4,4-hexafluoropentane-1,5-diol |
Safety and Handling
RTECSNumber : SA0750000
TSCA : Yes