missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2,2-Bis(4-hydroxyphenyl)hexafluoropropane 98.0+%, TCI America™
$37.52 - $282.43
Chemical Identifiers
| CAS | 1478-61-1 |
|---|---|
| Molecular Formula | C15H10F6O2 |
| Molecular Weight (g/mol) | 336.23 |
| MDL Number | MFCD00000439 |
| InChI Key | ZFVMWEVVKGLCIJ-UHFFFAOYSA-N |
| Synonym | bisphenol af, 4,4'-hexafluoroisopropylidene diphenol, 2,2-bis 4-hydroxyphenyl hexafluoropropane, hexafluorobisphenol a, biphenol af, 4,4'-perfluoropropane-2,2-diyl diphenol, hexafluoroisopropylidenebis 4-hydroxybenzene, hexafluorodiphenylolpropane, hexafluoroacetone bisphenol a, 2,2-bis 4-hydroxyphenyl perfluoropropane |
| PubChem CID | 73864 |
| ChEBI | CHEBI:72754 |
| IUPAC Name | 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol |
| SMILES | OC1=CC=C(C=C1)C(C1=CC=C(O)C=C1)(C(F)(F)F)C(F)(F)F |
Chemical Identifiers
| 1478-61-1 | |
| 336.23 | |
| ZFVMWEVVKGLCIJ-UHFFFAOYSA-N | |
| 73864 | |
| 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol |
| C15H10F6O2 | |
| MFCD00000439 | |
| bisphenol af, 4,4'-hexafluoroisopropylidene diphenol, 2,2-bis 4-hydroxyphenyl hexafluoropropane, hexafluorobisphenol a, biphenol af, 4,4'-perfluoropropane-2,2-diyl diphenol, hexafluoroisopropylidenebis 4-hydroxybenzene, hexafluorodiphenylolpropane, hexafluoroacetone bisphenol a, 2,2-bis 4-hydroxyphenyl perfluoropropane | |
| CHEBI:72754 | |
| OC1=CC=C(C=C1)C(C1=CC=C(O)C=C1)(C(F)(F)F)C(F)(F)F |
Specifications
| 1478-61-1 | |
| C15H10F6O2 | |
| 5 g | |
| ZFVMWEVVKGLCIJ-UHFFFAOYSA-N | |
| 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol | |
| 73864 | |
| 336.23 | |
| Crystalline Powder |
| 161°C | |
| MFCD00000439 | |
| bisphenol af, 4,4'-hexafluoroisopropylidene diphenol, 2,2-bis 4-hydroxyphenyl hexafluoropropane, hexafluorobisphenol a, biphenol af, 4,4'-perfluoropropane-2,2-diyl diphenol, hexafluoroisopropylidenebis 4-hydroxybenzene, hexafluorodiphenylolpropane, hexafluoroacetone bisphenol a, 2,2-bis 4-hydroxyphenyl perfluoropropane | |
| OC1=CC=C(C=C1)C(C1=CC=C(O)C=C1)(C(F)(F)F)C(F)(F)F | |
| 336.23 | |
| CHEBI:72754 | |
| ≥98.0% (GC) | |
| 2,2-Bis(4-hydroxyphenyl)hexafluoropropane |
Safety and Handling
EINECSNumber : (4)-1335
RTECSNumber : SN2780000
TSCA : Yes