missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2,2'-Dithiodibenzoic Acid 96.0+%, TCI America™
Supplier: TCI America D143725G
Specifications
| 2,2′-Dithiodibenzoic Acid | |
| C14H10O4S2 | |
| 25 g | |
| LBEMXJWGHIEXRA-UHFFFAOYSA-N | |
| 2-[(2-carboxyphenyl)disulfanyl]benzoic acid | |
| 8409 | |
| ≥96.0% (HPLC,T) |
| 119-80-2 | |
| MFCD00002465 | |
| 2,2'-dithiodibenzoic acid, 2,2'-dithiosalicylic acid, benzoic acid, 2,2'-dithiobis, 2-2-carboxyphenyl disulfanyl benzoic acid, bis 2-carboxyphenyl disulfide, bis o-carboxylphenyl disulfide, 2,2-dithiosalicylic acid, 2,2'-dithiobisbenzoic acid, unii-58mgb5279d, 2,2'-dithiodi benzoic acid | |
| C1=CC=C(C(=C1)C(=O)O)SSC2=CC=CC=C2C(=O)O | |
| 306.35 | |
| 306.35 | |
| Crystalline Powder |
Chemical Identifiers
| 119-80-2 | |
| 306.35 | |
| LBEMXJWGHIEXRA-UHFFFAOYSA-N | |
| 8409 | |
| C1=CC=C(C(=C1)C(=O)O)SSC2=CC=CC=C2C(=O)O |
| C14H10O4S2 | |
| MFCD00002465 | |
| 2,2'-dithiodibenzoic acid, 2,2'-dithiosalicylic acid, benzoic acid, 2,2'-dithiobis, 2-2-carboxyphenyl disulfanyl benzoic acid, bis 2-carboxyphenyl disulfide, bis o-carboxylphenyl disulfide, 2,2-dithiosalicylic acid, 2,2'-dithiobisbenzoic acid, unii-58mgb5279d, 2,2'-dithiodi benzoic acid | |
| 2-[(2-carboxyphenyl)disulfanyl]benzoic acid |
Safety and Handling
EINECSNumber : (3)-3077&(9)-1865
RTECSNumber : DG9660000
TSCA : Yes