missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2-(3-Chlorophenoxy)propionic Acid 98.0+%, TCI America™
Supplier: TCI America C109425G
Specifications
| 2-(3-Chlorophenoxy)propionic Acid | |
| 114°C | |
| MFCD00009723 | |
| 2-3-chlorophenoxy propionic acid, cloprop, 2-3-chlorophenoxy propanoic acid, metachlorphenprop, fruitone cpa, propanoic acid, 2-3-chlorophenoxy, 2-3-chlorophenoxy-propionic acid, amchem 3-cp, caswell no. 206, cloprop iso:prop | |
| CC(C(=O)O)OC1=CC(=CC=C1)Cl | |
| 200.618 | |
| 200.62 | |
| Crystalline Powder |
| 101-10-0 | |
| C9H9ClO3 | |
| 25 g | |
| YNTJKQDWYXUTLZ-UHFFFAOYSA-N | |
| 2-(3-chlorophenoxy)propanoic acid | |
| 7542 | |
| ≥98.0% (T) |
Chemical Identifiers
| 101-10-0 | |
| 200.618 | |
| YNTJKQDWYXUTLZ-UHFFFAOYSA-N | |
| 7542 | |
| CC(C(=O)O)OC1=CC(=CC=C1)Cl |
| C9H9ClO3 | |
| MFCD00009723 | |
| 2-3-chlorophenoxy propionic acid, cloprop, 2-3-chlorophenoxy propanoic acid, metachlorphenprop, fruitone cpa, propanoic acid, 2-3-chlorophenoxy, 2-3-chlorophenoxy-propionic acid, amchem 3-cp, caswell no. 206, cloprop iso:prop | |
| 2-(3-chlorophenoxy)propanoic acid |
Safety and Handling
RTECSNumber : UE9285000
TSCA : Yes