missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2,4-Dichloronitrobenzene 99.0+%, TCI America™
$38.16 - $277.05
Chemical Identifiers
| CAS | 611-06-3 |
|---|---|
| Molecular Formula | C6H3Cl2NO2 |
| Molecular Weight (g/mol) | 191.995 |
| MDL Number | MFCD00007071 |
| InChI Key | QUIMTLZDMCNYGY-UHFFFAOYSA-N |
| Synonym | 2,4-dichloronitrobenzene, 1,3-dichloro-4-nitrobenzene, benzene, 2,4-dichloro-1-nitro, unii-85p1a896rr, ccris 3095, benzene, 1,3-dichloro-4-nitro, nitro-m-dichlorobenzene, pubchem15890, 2,4-dichloronitrobenzen, 4-nitro-m-dichlorobenzene |
| PubChem CID | 11899 |
| IUPAC Name | 2,4-dichloro-1-nitrobenzene |
| SMILES | C1=CC(=C(C=C1Cl)Cl)[N+](=O)[O-] |
Chemical Identifiers
| 611-06-3 | |
| 191.995 | |
| QUIMTLZDMCNYGY-UHFFFAOYSA-N | |
| 11899 | |
| C1=CC(=C(C=C1Cl)Cl)[N+](=O)[O-] |
| C6H3Cl2NO2 | |
| MFCD00007071 | |
| 2,4-dichloronitrobenzene, 1,3-dichloro-4-nitrobenzene, benzene, 2,4-dichloro-1-nitro, unii-85p1a896rr, ccris 3095, benzene, 1,3-dichloro-4-nitro, nitro-m-dichlorobenzene, pubchem15890, 2,4-dichloronitrobenzen, 4-nitro-m-dichlorobenzene | |
| 2,4-dichloro-1-nitrobenzene |
Specifications
| 611-06-3 | |
| 259°C | |
| MFCD00007071 | |
| 2811 | |
| QUIMTLZDMCNYGY-UHFFFAOYSA-N | |
| 2,4-dichloro-1-nitrobenzene | |
| 11899 | |
| ≥99.0% (GC) | |
| 2,4-Dichloronitrobenzene |
| White-Yellow | |
| C6H3Cl2NO2 | |
| 25 g | |
| 2,4-dichloronitrobenzene, 1,3-dichloro-4-nitrobenzene, benzene, 2,4-dichloro-1-nitro, unii-85p1a896rr, ccris 3095, benzene, 1,3-dichloro-4-nitro, nitro-m-dichlorobenzene, pubchem15890, 2,4-dichloronitrobenzen, 4-nitro-m-dichlorobenzene | |
| C1=CC(=C(C=C1Cl)Cl)[N+](=O)[O-] | |
| 191.995 | |
| 192.00 | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : (3)-0455
RTECSNumber : CZ5420000
TSCA : Yes