missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2-(4-Nitrophenyl)ethanol 98.0+%, TCI America™
$104.68 - $418.70
Chemical Identifiers
| CAS | 100-27-6 |
|---|---|
| Molecular Formula | C8H9NO3 |
| Molecular Weight (g/mol) | 167.164 |
| MDL Number | MFCD00010202 |
| InChI Key | IKMXRUOZUUKSON-UHFFFAOYSA-N |
| Synonym | 4-nitrophenethyl alcohol, 2-4-nitrophenyl ethanol, 4-nitrobenzeneethanol, 2-p-nitrophenyl ethanol, benzeneethanol, 4-nitro, p-nitrophenethyl alcohol, 2-4-nitrophenyl ethan-1-ol, phenethyl alcohol, p-nitro, ccris 6079, 4-nitrophenethylalcohol |
| PubChem CID | 7494 |
| IUPAC Name | 2-(4-nitrophenyl)ethanol |
| SMILES | C1=CC(=CC=C1CCO)[N+](=O)[O-] |
Chemical Identifiers
| 100-27-6 | |
| 167.164 | |
| IKMXRUOZUUKSON-UHFFFAOYSA-N | |
| 7494 | |
| C1=CC(=CC=C1CCO)[N+](=O)[O-] |
| C8H9NO3 | |
| MFCD00010202 | |
| 4-nitrophenethyl alcohol, 2-4-nitrophenyl ethanol, 4-nitrobenzeneethanol, 2-p-nitrophenyl ethanol, benzeneethanol, 4-nitro, p-nitrophenethyl alcohol, 2-4-nitrophenyl ethan-1-ol, phenethyl alcohol, p-nitro, ccris 6079, 4-nitrophenethylalcohol | |
| 2-(4-nitrophenyl)ethanol |
Specifications
| 100-27-6 | |
| Yellow | |
| C8H9NO3 | |
| 5 g | |
| IKMXRUOZUUKSON-UHFFFAOYSA-N | |
| 2-(4-nitrophenyl)ethanol | |
| 7494 | |
| ≥98.0% (GC) | |
| 2-(4-Nitrophenyl)ethanol |
| 62°C | |
| 148°C | |
| MFCD00010202 | |
| 4-nitrophenethyl alcohol, 2-4-nitrophenyl ethanol, 4-nitrobenzeneethanol, 2-p-nitrophenyl ethanol, benzeneethanol, 4-nitro, p-nitrophenethyl alcohol, 2-4-nitrophenyl ethan-1-ol, phenethyl alcohol, p-nitro, ccris 6079, 4-nitrophenethylalcohol | |
| C1=CC(=CC=C1CCO)[N+](=O)[O-] | |
| 167.164 | |
| 167.16 | |
| Crystalline Powder |
Safety and Handling
RTECSNumber : SG8602000
TSCA : Yes