missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2-(4-Nitrophenyl)ethylamine Hydrochloride 98.0+%, TCI America™
Supplier: TCI America N064825G
Specifications
| 2-(4-Nitrophenyl)ethylamine Hydrochloride | |
| 214°C | |
| C8H11N2O2 | |
| 25 g | |
| IOXOZOPLBFXYLM-UHFFFAOYSA-O | |
| 2-(4-nitrophenyl)ethan-1-aminium | |
| 458983 | |
| ≥98.0% (HPLC,T) |
| 29968-78-3 | |
| Yellow | |
| MFCD00012900 | |
| 4-nitrophenethylamine hydrochloride, 4-nitrophenylethylamine hydrochloride, 4-nitrophenethylamine hcl, 2-4-nitrophenyl ethanamine hydrochloride, 2-4-nitrophenyl ethylamine hydrochloride, p-nitrophenylethylamine hcl, benzeneethanamine, 4-nitro-, monohydrochloride, 4-nitrophenethylaminehydrochloride, p-nitrophenethylamine, hydrochloride, pubchem11627 | |
| [NH3+]CCC1=CC=C(C=C1)[N+]([O-])=O | |
| 167.19 | |
| 202.64 | |
| Crystalline Powder |
Chemical Identifiers
| 29968-78-3 | |
| 167.19 | |
| IOXOZOPLBFXYLM-UHFFFAOYSA-O | |
| 458983 | |
| [NH3+]CCC1=CC=C(C=C1)[N+]([O-])=O |
| C8H11N2O2 | |
| MFCD00012900 | |
| 4-nitrophenethylamine hydrochloride, 4-nitrophenylethylamine hydrochloride, 4-nitrophenethylamine hcl, 2-4-nitrophenyl ethanamine hydrochloride, 2-4-nitrophenyl ethylamine hydrochloride, p-nitrophenylethylamine hcl, benzeneethanamine, 4-nitro-, monohydrochloride, 4-nitrophenethylaminehydrochloride, p-nitrophenethylamine, hydrochloride, pubchem11627 | |
| 2-(4-nitrophenyl)ethan-1-aminium |
Safety and Handling
TSCA : No