missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2,5-Dimethylbenzenesulfonyl chloride, 98%, Thermo Scientific™
$52.37 - $111.93
Chemical Identifiers
| CAS | 19040-62-1 |
|---|---|
| Molecular Formula | C8H9ClO2S |
| Molecular Weight (g/mol) | 204.668 |
| MDL Number | MFCD00024875 |
| InChI Key | FZVZUIBYLZZOEW-UHFFFAOYSA-N |
| Synonym | p-xylene-2-sulfonyl chloride, benzenesulfonyl chloride, 2,5-dimethyl, 2,5-dimethylbenzene-1-sulfonyl chloride, 2,5-dimethylphenylsulfonyl chloride, 2,5-dimethyl-benzenesulfonyl chloride, benzenesulfonylchloride, 2,5-dimethyl, 2,5-dimethylphenyl chlorosulfone, acmc-209etq, xylenesulfonylchloride, ksc178m0f |
| PubChem CID | 87910 |
| IUPAC Name | 2,5-dimethylbenzenesulfonyl chloride |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)Cl |
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 19040-62-1 | |
| 204.668 | |
| FZVZUIBYLZZOEW-UHFFFAOYSA-N | |
| 87910 | |
| CC1=CC(=C(C=C1)C)S(=O)(=O)Cl |
| C8H9ClO2S | |
| MFCD00024875 | |
| p-xylene-2-sulfonyl chloride, benzenesulfonyl chloride, 2,5-dimethyl, 2,5-dimethylbenzene-1-sulfonyl chloride, 2,5-dimethylphenylsulfonyl chloride, 2,5-dimethyl-benzenesulfonyl chloride, benzenesulfonylchloride, 2,5-dimethyl, 2,5-dimethylphenyl chlorosulfone, acmc-209etq, xylenesulfonylchloride, ksc178m0f | |
| 2,5-dimethylbenzenesulfonyl chloride |
Specifications
| 20°C | |
| Yellow | |
| 1 g | |
| C8H9ClO2S | |
| UN3265 | |
| FZVZUIBYLZZOEW-UHFFFAOYSA-N | |
| 2,5-dimethylbenzenesulfonyl chloride | |
| 87910 | |
| 98% |
| 19040-62-1 | |
| 120°C to 125°C | |
| Liquid/Solid | |
| MFCD00024875 | |
| p-xylene-2-sulfonyl chloride, benzenesulfonyl chloride, 2,5-dimethyl, 2,5-dimethylbenzene-1-sulfonyl chloride, 2,5-dimethylphenylsulfonyl chloride, 2,5-dimethyl-benzenesulfonyl chloride, benzenesulfonylchloride, 2,5-dimethyl, 2,5-dimethylphenyl chlorosulfone, acmc-209etq, xylenesulfonylchloride, ksc178m0f | |
| CC1=CC(=C(C=C1)C)S(=O)(=O)Cl | |
| 204.668 | |
| 204.68 | |
| 2,5-Dimethylbenzenesulfonyl chloride |
Safety and Handling
GHS H Statement
H314-H318
Causes severe skin burns and eye damage.
Causes serious eye damage.
P260-P264b-P271-P280-P301+P330+P331-P303+P361+P353-P304+P340-P305+P351+P338-P310-P363-P501c
H314-H335
DOTInformation : Transport Hazard Class: 8; Packing Group: II; Proper Shipping Name: CORROSIVE LIQUID, ACIDIC, ORGANIC, N.O.S.
RTECSNumber : DB8927600
TSCA : Yes
Recommended Storage : Ambient temperatures; Store under Nitrogen