missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2,6-Di-tert-butyl-4-dimethylaminomethylphenol 98.0+%, TCI America™
$98.75 - $448.32
Chemical Identifiers
| CAS | 88-27-7 |
|---|---|
| Molecular Formula | C17H29NO |
| Molecular Weight (g/mol) | 263.425 |
| MDL Number | MFCD00026283 |
| InChI Key | VMZVBRIIHDRYGK-UHFFFAOYSA-N |
| Synonym | ethyl 703, 2,6-di-tert-butyl-4-dimethylaminomethyl phenol, n,n-dimethyl-3,5-di-tert-butyl-4-hydroxybenzylamine, agidol 3, f 1 antioxidant, ethyl antioxidant 703, 2,6-di-tert-butyl-4-dimethylamino methylphenol, unii-8tk6vr2kyx, 2,6-di-tert-butyl-alpha-dimethylamino-p-cresol, n-3,5-di-tert-butyl-4-hydroxybenzyl dimethylamine |
| PubChem CID | 66609 |
| IUPAC Name | 2,6-ditert-butyl-4-[(dimethylamino)methyl]phenol |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CN(C)C |
Chemical Identifiers
| 88-27-7 | |
| 263.425 | |
| VMZVBRIIHDRYGK-UHFFFAOYSA-N | |
| 66609 | |
| CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CN(C)C |
| C17H29NO | |
| MFCD00026283 | |
| ethyl 703, 2,6-di-tert-butyl-4-dimethylaminomethyl phenol, n,n-dimethyl-3,5-di-tert-butyl-4-hydroxybenzylamine, agidol 3, f 1 antioxidant, ethyl antioxidant 703, 2,6-di-tert-butyl-4-dimethylamino methylphenol, unii-8tk6vr2kyx, 2,6-di-tert-butyl-alpha-dimethylamino-p-cresol, n-3,5-di-tert-butyl-4-hydroxybenzyl dimethylamine | |
| 2,6-ditert-butyl-4-[(dimethylamino)methyl]phenol |
Specifications
| 88-27-7 | |
| White-Yellow | |
| C17H29NO | |
| 25 g | |
| VMZVBRIIHDRYGK-UHFFFAOYSA-N | |
| 2,6-ditert-butyl-4-[(dimethylamino)methyl]phenol | |
| 66609 | |
| ≥98.0% (HPLC,T) | |
| 2,6-Di-tert-butyl-4-dimethylaminomethylphenol |
| 94°C | |
| 179°C | |
| MFCD00026283 | |
| ethyl 703, 2,6-di-tert-butyl-4-dimethylaminomethyl phenol, n,n-dimethyl-3,5-di-tert-butyl-4-hydroxybenzylamine, agidol 3, f 1 antioxidant, ethyl antioxidant 703, 2,6-di-tert-butyl-4-dimethylamino methylphenol, unii-8tk6vr2kyx, 2,6-di-tert-butyl-alpha-dimethylamino-p-cresol, n-3,5-di-tert-butyl-4-hydroxybenzyl dimethylamine | |
| CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CN(C)C | |
| 263.425 | |
| 263.43 | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : (3)-2865
RTECSNumber : GO7887000
TSCA : Yes