Learn More
2,6-Di-tert-butylphenol, 99%
CAS: 128-39-2 | C14H22O | 206.33 g/mol
Supplier: Thermo Scientific Chemicals 113000010
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| 2, 6-Di-tert-butylphenol | |
| 98.5 | |
| 35°C to 38°C | |
| 253°C | |
| Authentic | |
| Glass bottle | |
| [(CH3)3C]2C6H3OH | |
| 1 kg | |
| 2,6-di-tert-butylphenol, 2,6-di-t-butylphenol, 2,6-bis tert-butyl phenol, 2,6-bis 1,1-dimethylethyl phenol, phenol, 2,6-bis 1,1-dimethylethyl, 2,6 di-tert-butylphenol, ethanox 701, isonox 103, ethyl 701, ethyl an 701 | |
| DKCPKDPYUFEZCP-UHFFFAOYSA-N | |
| 2,6-ditert-butylphenol | |
| 31405 | |
| 99% |
| 128-39-2 | |
| 100.0 | |
| White to Yellow | |
| 118°C | |
| 99% | |
| C14H22O | |
| MFCD00008820 | |
| 06, III, 2061 | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohol and benzene | |
| CC(C)(C)C1=CC=CC(=C1O)C(C)(C)C | |
| 206.33 | |
| 206.33 | |
| Crystalline Solid |
Chemical Identifiers
| 128-39-2 | |
| 206.33 | |
| DKCPKDPYUFEZCP-UHFFFAOYSA-N | |
| 31405 | |
| CC(C)(C)C1=CC=CC(=C1O)C(C)(C)C |
| C14H22O | |
| MFCD00008820 | |
| 2,6-di-tert-butylphenol, 2,6-di-t-butylphenol, 2,6-bis tert-butyl phenol, 2,6-bis 1,1-dimethylethyl phenol, phenol, 2,6-bis 1,1-dimethylethyl, 2,6 di-tert-butylphenol, ethanox 701, isonox 103, ethyl 701, ethyl an 701 | |
| 2,6-ditert-butylphenol |
Safety and Handling
GHS H Statement
Toxic to aquatic life with long lasting effects.
Harmful if swallowed.
GHS P Statement
Avoid release to the environment.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
GHS Signal Word: Warning
EINECSNumber : 204-884-
RUO – Research Use Only