missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2-Bromo-4-nitroaniline 98.0+%, TCI America™
Supplier: TCI America B48731G
Specifications
| 2-Bromo-4-nitroaniline | |
| 106°C | |
| C6H5BrN2O2 | |
| 1 g | |
| C1=CC(=C(C=C1[N+](=O)[O-])Br)N | |
| 217.022 | |
| 217.02 | |
| Crystalline Powder |
| 13296-94-1 | |
| Yellow | |
| MFCD00025152 | |
| CGPPWNTVTNCHDO-UHFFFAOYSA-N | |
| 2-bromo-4-nitroaniline | |
| 25840 | |
| ≥98.0% (GC) |
Chemical Identifiers
| 13296-94-1 | |
| 217.022 | |
| CGPPWNTVTNCHDO-UHFFFAOYSA-N | |
| 2-bromo-4-nitroaniline |
| C6H5BrN2O2 | |
| MFCD00025152 | |
| 25840 | |
| C1=CC(=C(C=C1[N+](=O)[O-])Br)N |
Safety and Handling
EINECSNumber : (3)-0409
RTECSNumber : BW9350000
TSCA : Yes