missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2-Chloro-4-phenylphenol 96.0+%, TCI America™
Supplier: TCI America C026325G
Specifications
| 2-Chloro-4-phenylphenol | |
| 79°C | |
| 322°C | |
| MFCD00045745 | |
| sanidril, 4-phenyl-2-chlorophenol, 3-chloro-4-hydroxybiphenyl, dowicide 4, 3-chlorobiphenyl-4-ol, 3-chloro-4-biphenylol, o-chloro-p-phenylphenol, 2-chloro-p-phenylphenol, 3-chloro-4-hydroxydiphenyl, phenol, 2-chloro-4-phenyl | |
| C1=CC=C(C=C1)C2=CC(=C(C=C2)O)Cl | |
| 204.653 | |
| 204.65 | |
| Crystalline Powder |
| 92-04-6 | |
| Red-White | |
| C12H9ClO | |
| 25 g | |
| BZWMYDJJDBFAPE-UHFFFAOYSA-N | |
| 2-chloro-4-phenylphenol | |
| 7074 | |
| ≥96.0% (GC) |
Chemical Identifiers
| 92-04-6 | |
| 204.653 | |
| BZWMYDJJDBFAPE-UHFFFAOYSA-N | |
| 7074 | |
| C1=CC=C(C=C1)C2=CC(=C(C=C2)O)Cl |
| C12H9ClO | |
| MFCD00045745 | |
| sanidril, 4-phenyl-2-chlorophenol, 3-chloro-4-hydroxybiphenyl, dowicide 4, 3-chlorobiphenyl-4-ol, 3-chloro-4-biphenylol, o-chloro-p-phenylphenol, 2-chloro-p-phenylphenol, 3-chloro-4-hydroxydiphenyl, phenol, 2-chloro-4-phenyl | |
| 2-chloro-4-phenylphenol |
Safety and Handling
RTECSNumber : DV6650000
TSCA : Yes