missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2-Naphthyl Phenyl Ketone 98.0+%, TCI America™
Supplier: TCI America B03015G
Specifications
| 2-Naphthyl Phenyl Ketone | |
| 82°C | |
| C17H12O | |
| 5 g | |
| SJNXJRVDSTZUFB-UHFFFAOYSA-N | |
| (naphthalen-2-yl)(phenyl)methanone | |
| 69516 | |
| ≥98.0% (GC) |
| 644-13-3 | |
| 225°C | |
| MFCD00004106 | |
| 2-benzoylnaphthalene, 2-naphthyl phenyl ketone, 2-benzonaphthone, naphthalen-2-yl phenyl methanone, methanone, 2-naphthalenylphenyl, 2'-benzonaphthone, ketone, 2-naphthyl phenyl, 2-naphthylphenylketone, beta-benzoylnaphthalene, 2-naphthyl phenyl methanone | |
| O=C(C1=CC=CC=C1)C1=CC=C2C=CC=CC2=C1 | |
| 232.28 | |
| 232.28 | |
| Crystalline Powder |
Chemical Identifiers
| 644-13-3 | |
| 232.28 | |
| SJNXJRVDSTZUFB-UHFFFAOYSA-N | |
| 69516 | |
| O=C(C1=CC=CC=C1)C1=CC=C2C=CC=CC2=C1 |
| C17H12O | |
| MFCD00004106 | |
| 2-benzoylnaphthalene, 2-naphthyl phenyl ketone, 2-benzonaphthone, naphthalen-2-yl phenyl methanone, methanone, 2-naphthalenylphenyl, 2'-benzonaphthone, ketone, 2-naphthyl phenyl, 2-naphthylphenylketone, beta-benzoylnaphthalene, 2-naphthyl phenyl methanone | |
| (naphthalen-2-yl)(phenyl)methanone |
Safety and Handling
TSCA : Yes