missing translation for 'onlineSavingsMsg'
Learn More
Learn More
2-Phenoxyethyl Methacrylate (stabilized with HQ + MEHQ) 85.0+%, TCI America™
Supplier: TCI America P2468100G
Specifications
| 2-Phenoxyethyl Methacrylate (stabilized with HQ + MEHQ) | |
| Yellow | |
| 260°C | |
| MFCD00053685 | |
| Methacrylic Acid 2-Phenoxyethyl Ester, Ethylene Glycol Monophenyl Ether Methacrylate | |
| CC(=C)C(=O)OCCOC1=CC=CC=C1 | |
| 206.241 | |
| 206.24 | |
| Liquid |
| 10595-06-9 | |
| <7 | |
| C12H14O3 | |
| 100 g | |
| CEXQWAAGPPNOQF-UHFFFAOYSA-N | |
| 2-phenoxyethyl 2-methylprop-2-enoate | |
| 66357 | |
| ≥85.0% (GC) |
Chemical Identifiers
| 10595-06-9 | |
| 206.241 | |
| CEXQWAAGPPNOQF-UHFFFAOYSA-N | |
| 66357 | |
| CC(=C)C(=O)OCCOC1=CC=CC=C1 |
| C12H14O3 | |
| MFCD00053685 | |
| Methacrylic Acid 2-Phenoxyethyl Ester, Ethylene Glycol Monophenyl Ether Methacrylate | |
| 2-phenoxyethyl 2-methylprop-2-enoate |
Safety and Handling
EINECSNumber : (3)-4214
RTECSNumber : 3286610
TSCA : Yes