missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2-Phenylphenol Sodium Salt Tetrahydrate 80.0+%, TCI America™
$63.21 - $237.00
Chemical Identifiers
| CAS | 132-27-4 |
|---|---|
| Molecular Formula | C12H9NaO |
| Molecular Weight (g/mol) | 192.193 |
| MDL Number | MFCD00002209 |
| InChI Key | KSQXVLVXUFHGJQ-UHFFFAOYSA-M |
| Synonym | sodium 1,1'-biphenyl-2-olate, sodium 2-biphenylate, sodium o-phenylphenate, 2-phenylphenol sodium salt, natriphene, orphenol, bactrol, o-phenylphenol sodium, sodium o-phenylphenol, dowicide a |
| PubChem CID | 23675735 |
| ChEBI | CHEBI:82371 |
| IUPAC Name | sodium;2-phenylphenolate |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2[O-].[Na+] |
Chemical Identifiers
| 132-27-4 | |
| 192.193 | |
| KSQXVLVXUFHGJQ-UHFFFAOYSA-M | |
| 23675735 | |
| sodium;2-phenylphenolate |
| C12H9NaO | |
| MFCD00002209 | |
| sodium 1,1'-biphenyl-2-olate, sodium 2-biphenylate, sodium o-phenylphenate, 2-phenylphenol sodium salt, natriphene, orphenol, bactrol, o-phenylphenol sodium, sodium o-phenylphenol, dowicide a | |
| CHEBI:82371 | |
| C1=CC=C(C=C1)C2=CC=CC=C2[O-].[Na+] |
Specifications
| 132-27-4 | |
| C12H9NaO | |
| 25 g | |
| sodium 1,1'-biphenyl-2-olate, sodium 2-biphenylate, sodium o-phenylphenate, 2-phenylphenol sodium salt, natriphene, orphenol, bactrol, o-phenylphenol sodium, sodium o-phenylphenol, dowicide a | |
| C1=CC=C(C=C1)C2=CC=CC=C2[O-].[Na+] | |
| 192.193 | |
| CHEBI:82371 | |
| ≥80.0% (T) | |
| 2-Phenylphenol Sodium Salt Tetrahydrate |
| 78°C | |
| MFCD00002209 | |
| 1759 | |
| KSQXVLVXUFHGJQ-UHFFFAOYSA-M | |
| sodium;2-phenylphenolate | |
| 23675735 | |
| 192.19 | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : (4)-0020
RTECSNumber : DV7700000
TSCA : Yes