missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
2-(Trifluoromethyl)cinnamic Acid 98.0+%, TCI America™
$66.37 - $192.44
Chemical Identifiers
| CAS | 2062-25-1 |
|---|---|
| Molecular Formula | C10H7F3O2 |
| Molecular Weight (g/mol) | 216.16 |
| MDL Number | MFCD00004381 |
| InChI Key | AMVYAIXPAGBXOM-AATRIKPKSA-N |
| Synonym | 2-trifluoromethyl cinnamic acid, o-trifluoromethyl cinnamic acid, 2-trifluoromethylcinnamic acid, e-3-2-trifluoromethyl phenyl acrylic acid, 2e-3-2-trifluoromethyl phenyl prop-2-enoic acid, 3-2-trifluoromethyl phenyl acrylic acid, 2e-3-2-trifluoroformyl phenyl acrylic acid, e-2-trifluoromethyl cinnamic acid, 3-2-trifluoromethyl-phenyl-acrylic acid |
| PubChem CID | 719625 |
| ChEBI | CHEBI:60703 |
| IUPAC Name | (2E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | OC(=O)\C=C\C1=CC=CC=C1C(F)(F)F |
Chemical Identifiers
| 2062-25-1 | |
| 216.16 | |
| AMVYAIXPAGBXOM-AATRIKPKSA-N | |
| 719625 | |
| (2E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoic acid |
| C10H7F3O2 | |
| MFCD00004381 | |
| 2-trifluoromethyl cinnamic acid, o-trifluoromethyl cinnamic acid, 2-trifluoromethylcinnamic acid, e-3-2-trifluoromethyl phenyl acrylic acid, 2e-3-2-trifluoromethyl phenyl prop-2-enoic acid, 3-2-trifluoromethyl phenyl acrylic acid, 2e-3-2-trifluoroformyl phenyl acrylic acid, e-2-trifluoromethyl cinnamic acid, 3-2-trifluoromethyl-phenyl-acrylic acid | |
| CHEBI:60703 | |
| OC(=O)\C=C\C1=CC=CC=C1C(F)(F)F |
Specifications
| 2062-25-1 | |
| White-Yellow | |
| MFCD00004381 | |
| 2-trifluoromethyl cinnamic acid, o-trifluoromethyl cinnamic acid, 2-trifluoromethylcinnamic acid, e-3-2-trifluoromethyl phenyl acrylic acid, 2e-3-2-trifluoromethyl phenyl prop-2-enoic acid, 3-2-trifluoromethyl phenyl acrylic acid, 2e-3-2-trifluoroformyl phenyl acrylic acid, e-2-trifluoromethyl cinnamic acid, 3-2-trifluoromethyl-phenyl-acrylic acid | |
| OC(=O)\C=C\C1=CC=CC=C1C(F)(F)F | |
| 216.16 | |
| CHEBI:60703 | |
| ≥98.0% (GC,T) | |
| 2-(Trifluoromethyl)cinnamic Acid |
| 204°C | |
| C10H7F3O2 | |
| 5 g | |
| AMVYAIXPAGBXOM-AATRIKPKSA-N | |
| (2E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoic acid | |
| 719625 | |
| 216.16 | |
| Crystalline Powder |
Safety and Handling
TSCA : No