missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
3-Amino-3-(4-methoxyphenyl)propionic Acid 98.0+%, TCI America™
Supplier: TCI America A25321G
Specifications
| 232°C | |
| 5678-45-5 | |
| C10H13NO3 | |
| 3-amino-3-4-methoxyphenyl propanoic acid, 3-amino-3-4-methoxyphenyl propionic acid, 3-amino-3-4-methoxy-phenyl-propionic acid, 3-p-methoxyphenyl-dl-beta-alanine, dl-3-amino-3-4-methoxy-phenyl-propionic acid, dl-beta-p-methoxyphenyl alanine, beta-4-methoxyphenyl-beta-aminopropionic acid, beta-amino-4-methoxybenzenepropanoic acid, rs-beta-amino-beta-4-methoxyphenyl propionic acid, s-3-amino-3-4-methoxyphenyl-propionic acid | |
| COC1=CC=C(C=C1)C(CC(=O)O)N | |
| 195.218 | |
| 195.22 | |
| 1 g |
| 3-Amino-3-(4-methoxyphenyl)propionic Acid | |
| White | |
| MFCD00187209 | |
| NYTANCDDCQVQHG-UHFFFAOYSA-N | |
| 3-amino-3-(4-methoxyphenyl)propanoic acid | |
| 585889 | |
| ≥98.0% (HPLC,T) | |
| Crystalline Powder |
Chemical Identifiers
| 5678-45-5 | |
| 195.218 | |
| NYTANCDDCQVQHG-UHFFFAOYSA-N | |
| 585889 | |
| COC1=CC=C(C=C1)C(CC(=O)O)N |
| C10H13NO3 | |
| MFCD00187209 | |
| 3-amino-3-4-methoxyphenyl propanoic acid, 3-amino-3-4-methoxyphenyl propionic acid, 3-amino-3-4-methoxy-phenyl-propionic acid, 3-p-methoxyphenyl-dl-beta-alanine, dl-3-amino-3-4-methoxy-phenyl-propionic acid, dl-beta-p-methoxyphenyl alanine, beta-4-methoxyphenyl-beta-aminopropionic acid, beta-amino-4-methoxybenzenepropanoic acid, rs-beta-amino-beta-4-methoxyphenyl propionic acid, s-3-amino-3-4-methoxyphenyl-propionic acid | |
| 3-amino-3-(4-methoxyphenyl)propanoic acid |
Safety and Handling
TSCA : No