missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
3-Nitrocinnamic Acid 98.0+%, TCI America™
$36.08 - $92.78
Chemical Identifiers
| CAS | 555-68-0 |
|---|---|
| Molecular Formula | C9H7NO4 |
| Molecular Weight (g/mol) | 193.158 |
| MDL Number | MFCD00007277 |
| InChI Key | WWXMVRYHLZMQIG-SNAWJCMRSA-N |
| Synonym | 3-nitrocinnamic acid, m-nitrocinnamic acid, 3-nitro-cinnamic acid, cinnamic acid, m-nitro, trans-3-nitrocinnamic acid, 3-nitrobenzenepropenoic acid, e-3-3-nitrophenyl-2-propenoic acid, 2e-3-3-nitrophenyl prop-2-enoic acid, 2e-3-3-nitrophenyl acrylic acid, unii-z5wu65j930 |
| PubChem CID | 687126 |
| ChEBI | CHEBI:60706 |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C=CC(=O)O |
Chemical Identifiers
| 555-68-0 | |
| 193.158 | |
| WWXMVRYHLZMQIG-SNAWJCMRSA-N | |
| 687126 | |
| C1=CC(=CC(=C1)[N+](=O)[O-])C=CC(=O)O |
| C9H7NO4 | |
| MFCD00007277 | |
| 3-nitrocinnamic acid, m-nitrocinnamic acid, 3-nitro-cinnamic acid, cinnamic acid, m-nitro, trans-3-nitrocinnamic acid, 3-nitrobenzenepropenoic acid, e-3-3-nitrophenyl-2-propenoic acid, 2e-3-3-nitrophenyl prop-2-enoic acid, 2e-3-3-nitrophenyl acrylic acid, unii-z5wu65j930 | |
| CHEBI:60706 |
Specifications
| 555-68-0 | |
| White-Yellow | |
| MFCD00007277 | |
| 3-nitrocinnamic acid, m-nitrocinnamic acid, 3-nitro-cinnamic acid, cinnamic acid, m-nitro, trans-3-nitrocinnamic acid, 3-nitrobenzenepropenoic acid, e-3-3-nitrophenyl-2-propenoic acid, 2e-3-3-nitrophenyl prop-2-enoic acid, 2e-3-3-nitrophenyl acrylic acid, unii-z5wu65j930 | |
| C1=CC(=CC(=C1)[N+](=O)[O-])C=CC(=O)O | |
| 687126 | |
| 193.16 | |
| Crystalline Powder |
| 205°C | |
| C9H7NO4 | |
| 5 g | |
| WWXMVRYHLZMQIG-SNAWJCMRSA-N | |
| 193.158 | |
| CHEBI:60706 | |
| ≥98.0% (T) | |
| 3-Nitrocinnamic Acid |
Safety and Handling
RTECSNumber : GE0352000
TSCA : Yes