missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-(2-Aminoethyl)benzenesulfonyl Fluoride Hydrochloride 99.0+%, TCI America™
Supplier: TCI America A22151G
Specifications
| 4-(2-Aminoethyl)benzenesulfonyl Fluoride Hydrochloride [for Biochemical Research] | |
| 183°C | |
| C8H11ClFNO2S | |
| 1 g | |
| 4-2-aminoethyl benzenesulfonyl fluoride hydrochloride, aebsf, aebsf hydrochloride, pefabloc sc, aebsf hcl, pefabloc, 4-2-aminoethyl benzene-1-sulfonyl fluoride hydrochloride, aebsf, hydrochloride, benzenesulfonyl fluoride, 4-2-aminoethyl-, hydrochloride, 4-2-aminoethyl benzenesulfonylfluoride hydrochloride | |
| C1=CC(=CC=C1CCN)S(=O)(=O)F.Cl | |
| 239.689 | |
| 239.69 | |
| Crystalline Powder |
| 30827-99-7 | |
| White-Yellow | |
| MFCD00132962 | |
| 3261 | |
| WRDABNWSWOHGMS-UHFFFAOYSA-N | |
| 4-(2-aminoethyl)benzenesulfonyl fluoride;hydrochloride | |
| 186136 | |
| ≥99.0% (HPLC) |
Chemical Identifiers
| 30827-99-7 | |
| 239.689 | |
| WRDABNWSWOHGMS-UHFFFAOYSA-N | |
| 186136 | |
| C1=CC(=CC=C1CCN)S(=O)(=O)F.Cl |
| C8H11ClFNO2S | |
| MFCD00132962 | |
| 4-2-aminoethyl benzenesulfonyl fluoride hydrochloride, aebsf, aebsf hydrochloride, pefabloc sc, aebsf hcl, pefabloc, 4-2-aminoethyl benzene-1-sulfonyl fluoride hydrochloride, aebsf, hydrochloride, benzenesulfonyl fluoride, 4-2-aminoethyl-, hydrochloride, 4-2-aminoethyl benzenesulfonylfluoride hydrochloride | |
| 4-(2-aminoethyl)benzenesulfonyl fluoride;hydrochloride |
Safety and Handling
TSCA : No
Recommended Storage : Freezer