missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-(4-Acetoxyphenyl)-2-butanone 96.0+%, TCI America™
Supplier: TCI America A236825G
Specifications
| 4-(4-Acetoxyphenyl)-2-butanone | |
| Yellow | |
| C12H14O3 | |
| 25 g | |
| UMIKWXDGXDJQJK-UHFFFAOYSA-N | |
| [4-(3-oxobutyl)phenyl] acetate | |
| 19137 | |
| ≥96.0% (GC) |
| 3572-06-3 | |
| 124°C | |
| MFCD00008704 | |
| 4-(3-Oxobutyl)phenyl Acetate, Acetic Acid 4-(3-Oxobutyl)phenyl Ester | |
| CC(=O)CCC1=CC=C(C=C1)OC(=O)C | |
| 206.24 | |
| 206.24 | |
| Liquid |
Chemical Identifiers
| 3572-06-3 | |
| 206.24 | |
| UMIKWXDGXDJQJK-UHFFFAOYSA-N | |
| 19137 | |
| CC(=O)CCC1=CC=C(C=C1)OC(=O)C |
| C12H14O3 | |
| MFCD00008704 | |
| 4-(3-Oxobutyl)phenyl Acetate, Acetic Acid 4-(3-Oxobutyl)phenyl Ester | |
| [4-(3-oxobutyl)phenyl] acetate |
Safety and Handling
RTECSNumber : EL8950000
TSCA : Yes