missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4,4″-Dibromo-p-terphenyl 95.0+%, TCI America™
Supplier: TCI America D33725G
Specifications
| 4,4′′-Dibromo-p-terphenyl | |
| 315°C | |
| MFCD00272889 | |
| 3152 | |
| VAIPJQIPFPRJKJ-UHFFFAOYSA-N | |
| 4-bromo-4'-(4-bromophenyl)-1,1'-biphenyl | |
| 12455998 | |
| ≥95.0% (GC) |
| 17788-94-2 | |
| C18H12Br2 | |
| 5 g | |
| 4,4-dibromo-p-terphenyl, 4,4-dibromo-1,1':4',1-terphenyl, 1,1':4',1-terphenyl, 4,4-dibromo, acmc-1c6h6, 1,4-bis 4-bromophenyl benzene, 4-bromo-4'-4-bromophenyl-1,1'-biphenyl, 1∼4∼,3∼4∼-dibromo-1∼1∼,2∼1∼:2∼4∼,3∼1∼-terphenyl, 4,4 inverted exclamation marka inverted exclamation marka-dibromo-p-terphenyl, 4,4 inverted exclamation marka inverted exclamation marka-dibromo-1,1 inverted exclamation marka:4 inverted exclamation marka,1 inverted exclamation marka inverted exclamation marka-terphenyl | |
| BrC1=CC=C(C=C1)C1=CC=C(C=C1)C1=CC=C(Br)C=C1 | |
| 388.10 | |
| 388.10 | |
| Crystalline Powder |
Chemical Identifiers
| 17788-94-2 | |
| 388.10 | |
| VAIPJQIPFPRJKJ-UHFFFAOYSA-N | |
| 12455998 | |
| BrC1=CC=C(C=C1)C1=CC=C(C=C1)C1=CC=C(Br)C=C1 |
| C18H12Br2 | |
| MFCD00272889 | |
| 4,4-dibromo-p-terphenyl, 4,4-dibromo-1,1':4',1-terphenyl, 1,1':4',1-terphenyl, 4,4-dibromo, acmc-1c6h6, 1,4-bis 4-bromophenyl benzene, 4-bromo-4'-4-bromophenyl-1,1'-biphenyl, 1∼4∼,3∼4∼-dibromo-1∼1∼,2∼1∼:2∼4∼,3∼1∼-terphenyl, 4,4 inverted exclamation marka inverted exclamation marka-dibromo-p-terphenyl, 4,4 inverted exclamation marka inverted exclamation marka-dibromo-1,1 inverted exclamation marka:4 inverted exclamation marka,1 inverted exclamation marka inverted exclamation marka-terphenyl | |
| 4-bromo-4'-(4-bromophenyl)-1,1'-biphenyl |
Safety and Handling
TSCA : No