missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Acetyl-4'-bromobiphenyl 98.0+%, TCI America™
Supplier: TCI America A141025G
Specifications
| 4-Acetyl-4′-bromobiphenyl | |
| 127°C | |
| C14H11BrO | |
| 25 g | |
| UUVKNCRMWPNBNM-UHFFFAOYSA-N | |
| 1-[4-(4-bromophenyl)phenyl]ethanone | |
| 79806 | |
| ≥98.0% (GC) |
| 5731-01-1 | |
| Yellow | |
| MFCD00143242 | |
| 4-acetyl-4'-bromobiphenyl, 4'-4-bromophenyl acetophenone, 1-4-4-bromophenyl phenyl ethanone, 4'-p-bromophenyl acetophenone, 1-4'-bromo-1,1'-biphenyl-4-yl ethanone, 4-acetyl-4'-bromodiphenyl, 4-bromo-4'-acetylbiphenyl, ethanone, 1-4'-bromo 1,1'-biphenyl-4-yl, 1-4'-bromo 1,1'-biphenyl-4-yl ethanone, 1-4'-bromo 1,1'-biphenyl-4-yl ethan-1-one | |
| CC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)Br | |
| 275.15 | |
| 275.15 | |
| Crystalline Powder |
Chemical Identifiers
| 5731-01-1 | |
| 275.15 | |
| UUVKNCRMWPNBNM-UHFFFAOYSA-N | |
| 79806 | |
| CC(=O)C1=CC=C(C=C1)C2=CC=C(C=C2)Br |
| C14H11BrO | |
| MFCD00143242 | |
| 4-acetyl-4'-bromobiphenyl, 4'-4-bromophenyl acetophenone, 1-4-4-bromophenyl phenyl ethanone, 4'-p-bromophenyl acetophenone, 1-4'-bromo-1,1'-biphenyl-4-yl ethanone, 4-acetyl-4'-bromodiphenyl, 4-bromo-4'-acetylbiphenyl, ethanone, 1-4'-bromo 1,1'-biphenyl-4-yl, 1-4'-bromo 1,1'-biphenyl-4-yl ethanone, 1-4'-bromo 1,1'-biphenyl-4-yl ethan-1-one | |
| 1-[4-(4-bromophenyl)phenyl]ethanone |
Safety and Handling
TSCA : No