missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Amino-2-nitrophenol 95.0+%, TCI America™
$75.05 - $207.38
Chemical Identifiers
| CAS | 119-34-6 |
|---|---|
| Molecular Formula | C6H6N2O3 |
| Molecular Weight (g/mol) | 154.125 |
| MDL Number | MFCD00007876 |
| InChI Key | WHODQVWERNSQEO-UHFFFAOYSA-N |
| Synonym | phenol, 4-amino-2-nitro, fourrine 57, 4-hydroxy-3-nitroaniline, 2-nitro-4-aminophenol, fourrine brown pr, oxidation base 25, fourrine brown propyl, o-nitro-p-aminophenol, p-amino-o-nitrophenol, c.i. oxidation base 25 |
| PubChem CID | 3417419 |
| ChEBI | CHEBI:82385 |
| IUPAC Name | 4-amino-2-nitrophenol |
| SMILES | C1=CC(=C(C=C1N)[N+](=O)[O-])O |
Chemical Identifiers
| 119-34-6 | |
| 154.125 | |
| WHODQVWERNSQEO-UHFFFAOYSA-N | |
| 3417419 | |
| 4-amino-2-nitrophenol |
| C6H6N2O3 | |
| MFCD00007876 | |
| phenol, 4-amino-2-nitro, fourrine 57, 4-hydroxy-3-nitroaniline, 2-nitro-4-aminophenol, fourrine brown pr, oxidation base 25, fourrine brown propyl, o-nitro-p-aminophenol, p-amino-o-nitrophenol, c.i. oxidation base 25 | |
| CHEBI:82385 | |
| C1=CC(=C(C=C1N)[N+](=O)[O-])O |
Specifications
| 119-34-6 | |
| C6H6N2O3 | |
| 5 g | |
| WHODQVWERNSQEO-UHFFFAOYSA-N | |
| 4-amino-2-nitrophenol | |
| 3417419 | |
| 154.13 | |
| Crystalline Powder |
| 129°C | |
| MFCD00007876 | |
| phenol, 4-amino-2-nitro, fourrine 57, 4-hydroxy-3-nitroaniline, 2-nitro-4-aminophenol, fourrine brown pr, oxidation base 25, fourrine brown propyl, o-nitro-p-aminophenol, p-amino-o-nitrophenol, c.i. oxidation base 25 | |
| C1=CC(=C(C=C1N)[N+](=O)[O-])O | |
| 154.125 | |
| CHEBI:82385 | |
| ≥95.0% (T) | |
| 4-Amino-2-nitrophenol |
Safety and Handling
EINECSNumber : (3)-0788
RTECSNumber : SJ6303000
TSCA : Yes