missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Aminohippuric Acid 99.0+%, TCI America™
Supplier: TCI America A031325G
Specifications
| 4-Aminohippuric Acid | |
| 197°C | |
| MFCD00007890 | |
| 4-aminohippuric acid, aminohippuric acid, p-aminohippuric acid, paha, glycine, n-4-aminobenzoyl, n-4-aminobenzoyl glycine, para-aminohippuric acid, aminohippurate, nefrotest, n-p-aminobenzoyl glycine | |
| C1=CC(=CC=C1C(=O)NCC(=O)O)N | |
| 194.19 | |
| CHEBI:104011 | |
| ≥99.0% (T) |
| 61-78-9 | |
| C9H10N2O3 | |
| 25 g | |
| HSMNQINEKMPTIC-UHFFFAOYSA-N | |
| 2-[(4-aminobenzoyl)amino]acetic acid | |
| 2148 | |
| 194.19 | |
| Crystalline Powder |
Chemical Identifiers
| 61-78-9 | |
| 194.19 | |
| HSMNQINEKMPTIC-UHFFFAOYSA-N | |
| 2148 | |
| 2-[(4-aminobenzoyl)amino]acetic acid |
| C9H10N2O3 | |
| MFCD00007890 | |
| 4-aminohippuric acid, aminohippuric acid, p-aminohippuric acid, paha, glycine, n-4-aminobenzoyl, n-4-aminobenzoyl glycine, para-aminohippuric acid, aminohippurate, nefrotest, n-p-aminobenzoyl glycine | |
| CHEBI:104011 | |
| C1=CC(=CC=C1C(=O)NCC(=O)O)N |
Safety and Handling
EINECSNumber : (9)-0111
TSCA : Yes