missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Benzyloxyphenyl 4-Hydroxyphenyl Sulfone 98.0+%, TCI America™
Supplier: TCI America B28585G
Specifications
| 4-Benzyloxyphenyl 4-Hydroxyphenyl Sulfone | |
| 170°C | |
| C19H16O4S | |
| UWPJWCBDMZHMTN-UHFFFAOYSA-N | |
| 4-(4-phenylmethoxyphenyl)sulfonylphenol | |
| 113063 | |
| ≥98.0% (HPLC,T) |
| 63134-33-8 | |
| White | |
| 5 g | |
| C1=CC=C(C=C1)COC2=CC=C(C=C2)S(=O)(=O)C3=CC=C(C=C3)O | |
| 340.393 | |
| 340.39 | |
| Crystalline Powder |
Chemical Identifiers
| 63134-33-8 | |
| 340.393 | |
| 113063 | |
| C1=CC=C(C=C1)COC2=CC=C(C=C2)S(=O)(=O)C3=CC=C(C=C3)O |
| C19H16O4S | |
| UWPJWCBDMZHMTN-UHFFFAOYSA-N | |
| 4-(4-phenylmethoxyphenyl)sulfonylphenol |
Safety and Handling
EINECSNumber : (3)-4366
TSCA : Yes