missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Nitroaniline 98.0+%, TCI America™
$72.16 - $314.44
Chemical Identifiers
| CAS | 100-01-6 |
|---|---|
| Molecular Formula | C6H6N2O2 |
| Molecular Weight (g/mol) | 138.13 |
| MDL Number | MFCD00007858 |
| InChI Key | TYMLOMAKGOJONV-UHFFFAOYSA-N |
| Synonym | p-nitroaniline, p-nitraniline, 4-nitrobenzenamine, p-aminonitrobenzene, 4-nitraniline, benzenamine, 4-nitro, p-nitrophenylamine, 1-amino-4-nitrobenzene, aniline, p-nitro, developer p |
| PubChem CID | 7475 |
| ChEBI | CHEBI:17064 |
| IUPAC Name | 4-nitroaniline |
| SMILES | NC1=CC=C(C=C1)[N+]([O-])=O |
Chemical Identifiers
| 100-01-6 | |
| 138.13 | |
| TYMLOMAKGOJONV-UHFFFAOYSA-N | |
| 7475 | |
| 4-nitroaniline |
| C6H6N2O2 | |
| MFCD00007858 | |
| p-nitroaniline, p-nitraniline, 4-nitrobenzenamine, p-aminonitrobenzene, 4-nitraniline, benzenamine, 4-nitro, p-nitrophenylamine, 1-amino-4-nitrobenzene, aniline, p-nitro, developer p | |
| CHEBI:17064 | |
| NC1=CC=C(C=C1)[N+]([O-])=O |
Specifications
| 100-01-6 | |
| 6.7 | |
| C6H6N2O2 | |
| 25 g | |
| p-nitroaniline, p-nitraniline, 4-nitrobenzenamine, p-aminonitrobenzene, 4-nitraniline, benzenamine, 4-nitro, p-nitrophenylamine, 1-amino-4-nitrobenzene, aniline, p-nitro, developer p | |
| NC1=CC=C(C=C1)[N+]([O-])=O | |
| 138.13 | |
| CHEBI:17064 | |
| ≥98.0% (GC) | |
| 4-Nitroaniline |
| 148°C | |
| 332°C | |
| MFCD00007858 | |
| 1661 | |
| TYMLOMAKGOJONV-UHFFFAOYSA-N | |
| 4-nitroaniline | |
| 7475 | |
| 138.13 | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : (3)-0392
RTECSNumber : BY7000000
TSCA : Yes