missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Nitrobenzoic Acid 99.0+%, TCI America™
Supplier: TCI America N0156500G
Specifications
| 4-Nitrobenzoic Acid | |
| 240°C | |
| C7H5NO4 | |
| 500 g | |
| OTLNPYWUJOZPPA-UHFFFAOYSA-N | |
| 167.12 | |
| CHEBI:262350 | |
| ≥99.0% (GC,T) |
| 62-23-7 | |
| Yellow | |
| MFCD00007352 | |
| 4-nitrobenzoic acid, p-nitrobenzoic acid, benzoic acid, 4-nitro, nitrodracylic acid, 4-nitrodracylic acid, 1-carboxy-4-nitrobenzene, benzoic acid, p-nitro, p-nitrobenzoicacid, p-nitrobenzenecarboxylic acid, kyselina p-nitrobenzoova | |
| C1=CC(=CC=C1C(=O)O)[N+](=O)[O-] | |
| 6108 | |
| 167.12 | |
| Crystalline Powder |
Chemical Identifiers
| 62-23-7 | |
| 167.12 | |
| OTLNPYWUJOZPPA-UHFFFAOYSA-N | |
| 6108 | |
| C1=CC(=CC=C1C(=O)O)[N+](=O)[O-] |
| C7H5NO4 | |
| MFCD00007352 | |
| 4-nitrobenzoic acid, p-nitrobenzoic acid, benzoic acid, 4-nitro, nitrodracylic acid, 4-nitrodracylic acid, 1-carboxy-4-nitrobenzene, benzoic acid, p-nitro, p-nitrobenzoicacid, p-nitrobenzenecarboxylic acid, kyselina p-nitrobenzoova | |
| CHEBI:262350 |
Safety and Handling
EINECSNumber : (3)-1505
RTECSNumber : DH5075000
TSCA : Yes