missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4-Nitrodiphenyl Ether 98.0+%, TCI America™
$77.03 - $246.87
Chemical Identifiers
| CAS | 620-88-2 |
|---|---|
| Molecular Formula | C12H9NO3 |
| Molecular Weight (g/mol) | 215.208 |
| MDL Number | MFCD00007320 |
| InChI Key | JDTMUJBWSGNMGR-UHFFFAOYSA-N |
| Synonym | 4-nitrophenyl phenyl ether, 4-nitrodiphenyl ether, p-nitrophenyl phenyl ether, benzene, 1-nitro-4-phenoxy, p-nitrodiphenyl ether, ether, 4-nitrophenyl phenyl, 4-nitrodifenylether, ether, p-nitrophenyl phenyl, 1-nitro-4-phenoxy-benzene, 4-nitrobiphenyl ether |
| PubChem CID | 12110 |
| IUPAC Name | 1-nitro-4-phenoxybenzene |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)[N+](=O)[O-] |
Chemical Identifiers
| 620-88-2 | |
| 215.208 | |
| JDTMUJBWSGNMGR-UHFFFAOYSA-N | |
| 12110 | |
| C1=CC=C(C=C1)OC2=CC=C(C=C2)[N+](=O)[O-] |
| C12H9NO3 | |
| MFCD00007320 | |
| 4-nitrophenyl phenyl ether, 4-nitrodiphenyl ether, p-nitrophenyl phenyl ether, benzene, 1-nitro-4-phenoxy, p-nitrodiphenyl ether, ether, 4-nitrophenyl phenyl, 4-nitrodifenylether, ether, p-nitrophenyl phenyl, 1-nitro-4-phenoxy-benzene, 4-nitrobiphenyl ether | |
| 1-nitro-4-phenoxybenzene |
Specifications
| 620-88-2 | |
| C12H9NO3 | |
| 5 g | |
| 4-nitrophenyl phenyl ether, 4-nitrodiphenyl ether, p-nitrophenyl phenyl ether, benzene, 1-nitro-4-phenoxy, p-nitrodiphenyl ether, ether, 4-nitrophenyl phenyl, 4-nitrodifenylether, ether, p-nitrophenyl phenyl, 1-nitro-4-phenoxy-benzene, 4-nitrobiphenyl ether | |
| C1=CC=C(C=C1)OC2=CC=C(C=C2)[N+](=O)[O-] | |
| 215.208 | |
| 215.21 | |
| Crystalline Powder |
| 61°C | |
| MFCD00007320 | |
| 3077 | |
| JDTMUJBWSGNMGR-UHFFFAOYSA-N | |
| 1-nitro-4-phenoxybenzene | |
| 12110 | |
| ≥98.0% (GC) | |
| 4-Nitrodiphenyl Ether |
Safety and Handling
RTECSNumber : KO2680000
TSCA : Yes