missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
4'-(trans-4-Amylcyclohexyl)biphenyl-4-carbonitrile 98.0+%, TCI America™
Supplier: TCI America A25685G
Specifications
| 4′-(trans-4-Amylcyclohexyl)biphenyl-4-carbonitrile | |
| 96°C | |
| 211°C | |
| MFCD01076317 | |
| 4'-trans-4-pentylcyclohexyl-1,1'-biphenyl-4-carbonitrile, trans-4'-4-pentylcyclohexyl-4-biphenylcarbonitrile, trans-4-4-pentylcyclohexyl-4'-cyanobiphenyl, 4-trans-4-n-pentylcyclohexyl biphenyl-4'-carbonitrile, 4-4-4-pentylcyclohexyl phenyl benzonitrile, 1,1'-biphenyl-4-carbonitrile, 4'-trans-4-pentylcyclohexyl, 4-cyano-4'-trans-4-pentylcyclohexyl biphenyl, 4'-trans-4-amylcyclohexyl biphenyl-4-carbonitrile, trans-4'-4-pentylcyclohexyl 1,1'-biphenyl-4-carbonitrile | |
| CCCCCC1CCC(CC1)C2=CC=C(C=C2)C3=CC=C(C=C3)C#N | |
| 331.503 | |
| 331.50 | |
| Crystalline Powder |
| 68065-81-6 | |
| White | |
| C24H29N | |
| 5 g | |
| QKEBUASRTJNJJS-UHFFFAOYSA-N | |
| 4-[4-(4-pentylcyclohexyl)phenyl]benzonitrile | |
| 106491 | |
| ≥98.0% (GC) |
Chemical Identifiers
| 68065-81-6 | |
| 331.503 | |
| QKEBUASRTJNJJS-UHFFFAOYSA-N | |
| 106491 | |
| CCCCCC1CCC(CC1)C2=CC=C(C=C2)C3=CC=C(C=C3)C#N |
| C24H29N | |
| MFCD01076317 | |
| 4'-trans-4-pentylcyclohexyl-1,1'-biphenyl-4-carbonitrile, trans-4'-4-pentylcyclohexyl-4-biphenylcarbonitrile, trans-4-4-pentylcyclohexyl-4'-cyanobiphenyl, 4-trans-4-n-pentylcyclohexyl biphenyl-4'-carbonitrile, 4-4-4-pentylcyclohexyl phenyl benzonitrile, 1,1'-biphenyl-4-carbonitrile, 4'-trans-4-pentylcyclohexyl, 4-cyano-4'-trans-4-pentylcyclohexyl biphenyl, 4'-trans-4-amylcyclohexyl biphenyl-4-carbonitrile, trans-4'-4-pentylcyclohexyl 1,1'-biphenyl-4-carbonitrile | |
| 4-[4-(4-pentylcyclohexyl)phenyl]benzonitrile |
Safety and Handling
TSCA : Yes