missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
![5-tert-Butyl N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-glutamate Hydrate 98.0+%, TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/product-images/Chemical Structure_B31675G.jpg-650.jpg)
![5-tert-Butyl N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-glutamate Hydrate 98.0+%, TCI America™](https://assets.fishersci.com/TFS-Assets/CCG/TCI-America/logos/Rings Blue.jpg-650.jpg)
5-tert-Butyl N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-glutamate Hydrate 98.0+%, TCI America™
Supplier: TCI America B31675G
Specifications
| 5-tert-Butyl N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-glutamate Hydrate | |
| 90°C | |
| C24H27NO6 | |
| 5 g | |
| OTKXCALUHMPIGM-FQEVSTJZSA-N | |
| (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid | |
| 2724637 | |
| ≥98.0% (HPLC,T) |
| 71989-18-9 | |
| White | |
| MFCD00037135 | |
| fmoc-glu otbu-oh, fmoc-l-glutamic acid 5-tert-butyl ester, 2s-5-tert-butoxy-2-9h-fluoren-9-ylmethoxy carbonyl amino-5-oxopentanoic acid, s-2-9h-fluoren-9-yl methoxy carbonyl amino-5-tert-butoxy-5-oxopentanoic acid, n-fmoc-l-glutamic acid 5-tert-butyl ester, fmoc-glu obut, fmoc-glu tbu, fmoc-l-glu otbu, pubchem12950, fmoc-l-glu otbu-oh | |
| CC(C)(C)OC(=O)CCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 | |
| 425.481 | |
| 425.48 | |
| Crystalline Powder |
Chemical Identifiers
| 71989-18-9 | |
| 425.481 | |
| OTKXCALUHMPIGM-FQEVSTJZSA-N | |
| 2724637 | |
| CC(C)(C)OC(=O)CCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| C24H27NO6 | |
| MFCD00037135 | |
| fmoc-glu otbu-oh, fmoc-l-glutamic acid 5-tert-butyl ester, 2s-5-tert-butoxy-2-9h-fluoren-9-ylmethoxy carbonyl amino-5-oxopentanoic acid, s-2-9h-fluoren-9-yl methoxy carbonyl amino-5-tert-butoxy-5-oxopentanoic acid, n-fmoc-l-glutamic acid 5-tert-butyl ester, fmoc-glu obut, fmoc-glu tbu, fmoc-l-glu otbu, pubchem12950, fmoc-l-glu otbu-oh | |
| (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
Safety and Handling
TSCA : No