missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
6-Amino-1-naphthol-3-sulfonic Acid Hydrate 95.0+%, TCI America™
Supplier: TCI America A037025G
Specifications
| 6-Amino-1-naphthol-3-sulfonic Acid Hydrate | |
| C10H9NO4S | |
| 25 g | |
| KYARBIJYVGJZLB-UHFFFAOYSA-N | |
| 7-amino-4-hydroxynaphthalene-2-sulfonic acid | |
| 6868 | |
| 239.25 | |
| Crystalline Powder |
| 87-02-5 | |
| MFCD00003970 | |
| 7-Amino-4-hydroxy-2-naphthalenesulfonic Acid, J Acid | |
| C1=CC2=C(C=C(C=C2C=C1N)S(=O)(=O)O)O | |
| 239.245 | |
| CHEBI:87316 | |
| ≥95.0% (HPLC,T) |
Chemical Identifiers
| 87-02-5 | |
| 239.245 | |
| KYARBIJYVGJZLB-UHFFFAOYSA-N | |
| 6868 | |
| 7-amino-4-hydroxynaphthalene-2-sulfonic acid |
| C10H9NO4S | |
| MFCD00003970 | |
| 7-Amino-4-hydroxy-2-naphthalenesulfonic Acid, J Acid | |
| CHEBI:87316 | |
| C1=CC2=C(C=C(C=C2C=C1N)S(=O)(=O)O)O |
Safety and Handling
EINECSNumber : (4)-0514
RTECSNumber : QK1295500
TSCA : Yes