missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
6-Carboxyfluorescein Hydrate 97.0+%, TCI America™
Supplier: TCI America C2478100MG
Specifications
| 6-Carboxyfluorescein Hydrate | |
| C21H12O7 | |
| 100 mg | |
| BZTDTCNHAFUJOG-UHFFFAOYSA-N | |
| 3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid | |
| 76806 | |
| 376.32 | |
| Crystalline Powder |
| 3301-79-9 | |
| MFCD00036873 | |
| 6-carboxyfluorescein, 6-fam, carboxyfluorescein, spiro isobenzofuran-1 3h ,9'-9h xanthene-6-carboxylic acid, 3',6'-dihydroxy-3-oxo, 3,6,9-trihydroxyxanthen-9-yl terephthalic acid, 3',6'-dihydroxy-3-oxo-3h-spiro 2-benzofuran-1,9'-xanthene-6-carboxylic acid, 3',6'-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-6-carboxylic acid, 5 6-carboxy fluorescein, bidd:gt0504 | |
| C1=CC2=C(C=C1C(=O)O)C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OC2=O | |
| 376.32 | |
| CHEBI:39073 | |
| ≥97.0% (HPLC) |
Chemical Identifiers
| 3301-79-9 | |
| 376.32 | |
| BZTDTCNHAFUJOG-UHFFFAOYSA-N | |
| 76806 | |
| 3',6'-dihydroxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carboxylic acid |
| C21H12O7 | |
| MFCD00036873 | |
| 6-carboxyfluorescein, 6-fam, carboxyfluorescein, spiro isobenzofuran-1 3h ,9'-9h xanthene-6-carboxylic acid, 3',6'-dihydroxy-3-oxo, 3,6,9-trihydroxyxanthen-9-yl terephthalic acid, 3',6'-dihydroxy-3-oxo-3h-spiro 2-benzofuran-1,9'-xanthene-6-carboxylic acid, 3',6'-dihydroxy-3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-6-carboxylic acid, 5 6-carboxy fluorescein, bidd:gt0504 | |
| CHEBI:39073 | |
| C1=CC2=C(C=C1C(=O)O)C3(C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O)OC2=O |
Safety and Handling
TSCA : Yes