missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
6-tert-Butyl-2,4-xylenol 97.0+%, TCI America™
$50.17 - $318.33
Chemical Identifiers
| CAS | 1879-09-0 |
|---|---|
| Molecular Formula | C12H18O |
| Molecular Weight (g/mol) | 178.28 |
| MDL Number | MFCD00002234 |
| InChI Key | OPLCSTZDXXUYDU-UHFFFAOYSA-N |
| Synonym | 2,4-dimethyl-6-tert-butylphenol, 2-tert-butyl-4,6-dimethylphenol, 6-tert-butyl-2,4-dimethylphenol, topanol a, 6-tert-butyl-2,4-xylenol, 6-t-butyl-2,4-xylenol, prodox 340, phenol, 2-1,1-dimethylethyl-4,6-dimethyl, 6-t-butyl-2,4-dimethylphenol, 2,4-xylenol, 6-tert-butyl |
| PubChem CID | 15884 |
| IUPAC Name | 2-tert-butyl-4,6-dimethylphenol |
| SMILES | CC1=CC(C)=C(O)C(=C1)C(C)(C)C |
Chemical Identifiers
| 1879-09-0 | |
| 178.28 | |
| OPLCSTZDXXUYDU-UHFFFAOYSA-N | |
| 15884 | |
| CC1=CC(C)=C(O)C(=C1)C(C)(C)C |
| C12H18O | |
| MFCD00002234 | |
| 2,4-dimethyl-6-tert-butylphenol, 2-tert-butyl-4,6-dimethylphenol, 6-tert-butyl-2,4-dimethylphenol, topanol a, 6-tert-butyl-2,4-xylenol, 6-t-butyl-2,4-xylenol, prodox 340, phenol, 2-1,1-dimethylethyl-4,6-dimethyl, 6-t-butyl-2,4-dimethylphenol, 2,4-xylenol, 6-tert-butyl | |
| 2-tert-butyl-4,6-dimethylphenol |
Specifications
| 1879-09-0 | |
| 249°C | |
| Crystal-Lump at 20°C | |
| MFCD00002234 | |
| 2,4-dimethyl-6-tert-butylphenol, 2-tert-butyl-4,6-dimethylphenol, 6-tert-butyl-2,4-dimethylphenol, topanol a, 6-tert-butyl-2,4-xylenol, 6-t-butyl-2,4-xylenol, prodox 340, phenol, 2-1,1-dimethylethyl-4,6-dimethyl, 6-t-butyl-2,4-dimethylphenol, 2,4-xylenol, 6-tert-butyl | |
| CC1=CC(C)=C(O)C(=C1)C(C)(C)C | |
| 178.28 | |
| 178.28 | |
| 6-tert-Butyl-2,4-xylenol |
| White-Yellow | |
| 25 g | |
| C12H18O | |
| 2811 | |
| OPLCSTZDXXUYDU-UHFFFAOYSA-N | |
| 2-tert-butyl-4,6-dimethylphenol | |
| 15884 | |
| ≥97.0% (GC) |
Safety and Handling
EINECSNumber : (3)-0540
RTECSNumber : ZE6825000
TSCA : Yes