missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Anisoin 97.0+%, TCI America™
$118.51 - $339.70
Chemical Identifiers
| CAS | 119-52-8 |
|---|---|
| Molecular Formula | C16H16O4 |
| Molecular Weight (g/mol) | 272.30 |
| MDL Number | MFCD00008411 |
| InChI Key | LRRQSCPPOIUNGX-UHFFFAOYNA-N |
| Synonym | anisoin, 2-hydroxy-1,2-bis 4-methoxyphenyl ethanone, 4,4'-dimethoxybenzoin, p-anisoin, ethanone, 2-hydroxy-1,2-bis 4-methoxyphenyl, benzoin, 4,4'-dimethoxy, p,p'-dimethoxybenzoin, benzoin,4'-dimethoxy, 4,4'-anisoin, 1,2-bis 4-methoxyphenyl-2-hydroxyethan-1-one |
| PubChem CID | 95415 |
| IUPAC Name | 2-hydroxy-1,2-bis(4-methoxyphenyl)ethan-1-one |
| SMILES | COC1=CC=C(C=C1)C(O)C(=O)C1=CC=C(OC)C=C1 |
Chemical Identifiers
| 119-52-8 | |
| 272.30 | |
| LRRQSCPPOIUNGX-UHFFFAOYNA-N | |
| 95415 | |
| COC1=CC=C(C=C1)C(O)C(=O)C1=CC=C(OC)C=C1 |
| C16H16O4 | |
| MFCD00008411 | |
| anisoin, 2-hydroxy-1,2-bis 4-methoxyphenyl ethanone, 4,4'-dimethoxybenzoin, p-anisoin, ethanone, 2-hydroxy-1,2-bis 4-methoxyphenyl, benzoin, 4,4'-dimethoxy, p,p'-dimethoxybenzoin, benzoin,4'-dimethoxy, 4,4'-anisoin, 1,2-bis 4-methoxyphenyl-2-hydroxyethan-1-one | |
| 2-hydroxy-1,2-bis(4-methoxyphenyl)ethan-1-one |
Specifications
| 119-52-8 | |
| White-Yellow | |
| MFCD00008411 | |
| anisoin, 2-hydroxy-1,2-bis 4-methoxyphenyl ethanone, 4,4'-dimethoxybenzoin, p-anisoin, ethanone, 2-hydroxy-1,2-bis 4-methoxyphenyl, benzoin, 4,4'-dimethoxy, p,p'-dimethoxybenzoin, benzoin,4'-dimethoxy, 4,4'-anisoin, 1,2-bis 4-methoxyphenyl-2-hydroxyethan-1-one | |
| COC1=CC=C(C=C1)C(O)C(=O)C1=CC=C(OC)C=C1 | |
| 272.30 | |
| 272.30 | |
| Crystalline Powder |
| 112°C | |
| C16H16O4 | |
| 25 g | |
| LRRQSCPPOIUNGX-UHFFFAOYNA-N | |
| 2-hydroxy-1,2-bis(4-methoxyphenyl)ethan-1-one | |
| 95415 | |
| ≥97.0% (HPLC) | |
| Anisoin |
Safety and Handling
EINECSNumber : (4)-0277
TSCA : Yes