missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Aspartame 98.0+%, TCI America™
$70.94 - $228.38
Chemical Identifiers
| CAS | 22839-47-0 |
|---|---|
| Molecular Formula | C14H18N2O5 |
| Molecular Weight (g/mol) | 294.31 |
| MDL Number | MFCD00002724 |
| InChI Key | IAOZJIPTCAWIRG-QWRGUYRKSA-N |
| Synonym | aspartame, nutrasweet, asp-phe-ome, asp-phe methyl ester, aspartam, aspartamum, aspartamo, l-aspartyl-l-phenylalanine methyl ester, aspartylphenylalanine methyl ester, dipeptide sweetener |
| PubChem CID | 134601 |
| ChEBI | CHEBI:2877 |
| IUPAC Name | (3S)-3-amino-3-{[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]carbamoyl}propanoic acid |
| SMILES | COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@@H](N)CC(O)=O |
Chemical Identifiers
| 22839-47-0 | |
| 294.31 | |
| IAOZJIPTCAWIRG-QWRGUYRKSA-N | |
| 134601 | |
| (3S)-3-amino-3-{[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]carbamoyl}propanoic acid |
| C14H18N2O5 | |
| MFCD00002724 | |
| aspartame, nutrasweet, asp-phe-ome, asp-phe methyl ester, aspartam, aspartamum, aspartamo, l-aspartyl-l-phenylalanine methyl ester, aspartylphenylalanine methyl ester, dipeptide sweetener | |
| CHEBI:2877 | |
| COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@@H](N)CC(O)=O |
Specifications
| 22839-47-0 | |
| C14H18N2O5 | |
| aspartame, nutrasweet, asp-phe-ome, asp-phe methyl ester, aspartam, aspartamum, aspartamo, l-aspartyl-l-phenylalanine methyl ester, aspartylphenylalanine methyl ester, dipeptide sweetener | |
| COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@@H](N)CC(O)=O | |
| 294.31 | |
| CHEBI:2877 | |
| ≥98.0% (HPLC,T) | |
| Crystalline Powder |
| White | |
| MFCD00002724 | |
| IAOZJIPTCAWIRG-QWRGUYRKSA-N | |
| (3S)-3-amino-3-{[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]carbamoyl}propanoic acid | |
| 134601 | |
| 294.31 | |
| 1 g | |
| Aspartame |
Safety and Handling
EINECSNumber : (9)-1616
RTECSNumber : WM3407000
TSCA : Yes