missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Benzethonium Chloride, 0.004 M (N), Ricca Chemical
Supplier: Ricca Chemical Company 95516
Specifications
| Benzethonium Chloride | |
| 121-54-0,7732-18-5 | |
| 100.0,0.18 | |
| benzethonium chloride, quatrachlor, hyamine, phemeride, phemerol chloride, benzethoniumchloride, phemithyn, disilyn, kylacol, solamin | |
| CC(C)(C)CC(C)(C)C1=CC=C(C=C1)OCCOCC[N+](C)(C)CC2=CC=CC=C2.[Cl-] | |
| 448.088 | |
| CHEBI:31264 | |
| 500 mL | |
| 0.004Molar |
| Colorless | |
| 98.0,0.18 | |
| C27H42ClNO2 | |
| UREZNYTWGJKWBI-UHFFFAOYSA-M | |
| benzyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium;chloride | |
| 8478 | |
| Poly Bottle | |
| Liquid |
Chemical Identifiers
| 121-54-0 | |
| 448.088 | |
| benzethonium chloride, quatrachlor, hyamine, phemeride, phemerol chloride, benzethoniumchloride, phemithyn, disilyn, kylacol, solamin | |
| CHEBI:31264 | |
| CC(C)(C)CC(C)(C)C1=CC=C(C=C1)OCCOCC[N+](C)(C)CC2=CC=CC=C2.[Cl-] |
| C27H42ClNO2 | |
| UREZNYTWGJKWBI-UHFFFAOYSA-M | |
| 8478 | |
| benzyl-dimethyl-[2-[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethoxy]ethyl]azanium;chloride |