missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Benzoin Ethyl Ether 99.0+%, TCI America™
Supplier: TCI America B1019500G
Specifications
| Benzoin Ethyl Ether | |
| 61°C | |
| 125°C | |
| MFCD00009242 | |
| 3077 | |
| KMNCBSZOIQAUFX-UHFFFAOYSA-N | |
| 2-ethoxy-1,2-diphenylethanone | |
| 101778 | |
| ≥99.0% (GC) |
| 574-09-4 | |
| White-Yellow | |
| C16H16O2 | |
| 500 g | |
| benzoin ethyl ether, ethanone, 2-ethoxy-1,2-diphenyl, 2-ethoxy-2-phenylacetophenone, 2-ethoxy-1,2-diphenylethan-1-one, 2-ethoxy-1,2-diphenyl-ethanone, 2-ethoxybenzoin, benzoinethylether, ethyl benzoin ether, 2-ethoxy-2-phenyl acetophenone | |
| CCOC(C1=CC=CC=C1)C(=O)C2=CC=CC=C2 | |
| 240.302 | |
| 240.30 | |
| Crystalline Powder |
Chemical Identifiers
| 574-09-4 | |
| 240.302 | |
| KMNCBSZOIQAUFX-UHFFFAOYSA-N | |
| 101778 | |
| CCOC(C1=CC=CC=C1)C(=O)C2=CC=CC=C2 |
| C16H16O2 | |
| MFCD00009242 | |
| benzoin ethyl ether, ethanone, 2-ethoxy-1,2-diphenyl, 2-ethoxy-2-phenylacetophenone, 2-ethoxy-1,2-diphenylethan-1-one, 2-ethoxy-1,2-diphenyl-ethanone, 2-ethoxybenzoin, benzoinethylether, ethyl benzoin ether, 2-ethoxy-2-phenyl acetophenone | |
| 2-ethoxy-1,2-diphenylethanone |
Safety and Handling
EINECSNumber : (4)-0079
TSCA : Yes