missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Benzoin Methyl Ether 98.0+%, TCI America™
Supplier: TCI America B0869500G
Specifications
| Benzoin Methyl Ether | |
| 50°C | |
| 189°C | |
| MFCD00008492 | |
| benzoin methyl ether, methyl benzoin, benzoin methyl ester, o-methylbenzoin, 2-methoxy-2-phenylacetophenone, nisso cure mbo, ethanone, 2-methoxy-1,2-diphenyl, acetophenone, 2-methoxy-2-phenyl, qcu 3, alpha-methoxydeoxybenzoin | |
| COC(C1=CC=CC=C1)C(=O)C2=CC=CC=C2 | |
| 226.275 | |
| 226.28 | |
| Crystalline Powder |
| 3524-62-7 | |
| White-Yellow | |
| C15H14O2 | |
| 500 g | |
| BQZJOQXSCSZQPS-UHFFFAOYSA-N | |
| 2-methoxy-1,2-diphenylethanone | |
| 98097 | |
| ≥98.0% (GC) |
Chemical Identifiers
| 3524-62-7 | |
| 226.275 | |
| BQZJOQXSCSZQPS-UHFFFAOYSA-N | |
| 98097 | |
| COC(C1=CC=CC=C1)C(=O)C2=CC=CC=C2 |
| C15H14O2 | |
| MFCD00008492 | |
| benzoin methyl ether, methyl benzoin, benzoin methyl ester, o-methylbenzoin, 2-methoxy-2-phenylacetophenone, nisso cure mbo, ethanone, 2-methoxy-1,2-diphenyl, acetophenone, 2-methoxy-2-phenyl, qcu 3, alpha-methoxydeoxybenzoin | |
| 2-methoxy-1,2-diphenylethanone |
Safety and Handling
EINECSNumber : (3)-1264&(4)-0079
RTECSNumber : AM9350000
TSCA : Yes