missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Benzoin Zone Refined (number of passes:40) 99.0+%, TCI America™
Supplier: TCI America B02221SAMPLE
Specifications
| Benzoin Zone Refined (number of passes:40) | |
| 135°C | |
| 344°C | |
| MFCD00004496 | |
| benzoin, 2-hydroxy-2-phenylacetophenone, benzoylphenylcarbinol, benzoin tincture, +--benzoin, ethanone, 2-hydroxy-1,2-diphenyl, bitter almond oil camphor, phenylbenzoyl carbinol, 2-hydroxy-1,2-diphenylethan-1-one, alpha-hydroxybenzyl phenyl ketone | |
| OC(C(=O)C1=CC=CC=C1)C1=CC=CC=C1 | |
| 212.25 | |
| CHEBI:17682 | |
| ≥99.0% (GC) |
| 119-53-9 | |
| White | |
| C14H12O2 | |
| ZONE | |
| ISAOCJYIOMOJEB-UHFFFAOYNA-N | |
| 2-hydroxy-1,2-diphenylethan-1-one | |
| 8400 | |
| 212.25 | |
| Crystals |
Chemical Identifiers
| 119-53-9 | |
| 212.25 | |
| ISAOCJYIOMOJEB-UHFFFAOYNA-N | |
| 8400 | |
| 2-hydroxy-1,2-diphenylethan-1-one |
| C14H12O2 | |
| MFCD00004496 | |
| benzoin, 2-hydroxy-2-phenylacetophenone, benzoylphenylcarbinol, benzoin tincture, +--benzoin, ethanone, 2-hydroxy-1,2-diphenyl, bitter almond oil camphor, phenylbenzoyl carbinol, 2-hydroxy-1,2-diphenylethan-1-one, alpha-hydroxybenzyl phenyl ketone | |
| CHEBI:17682 | |
| OC(C(=O)C1=CC=CC=C1)C1=CC=CC=C1 |
Safety and Handling
EINECSNumber : (9)-1315
RTECSNumber : DI1590000
TSCA : Yes