missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Benzopinacol 95.0+%, TCI America™
$41.52 - $164.37
Chemical Identifiers
| CAS | 464-72-2 |
|---|---|
| Molecular Formula | C26H22O2 |
| Molecular Weight (g/mol) | 366.46 |
| MDL Number | MFCD00004448 |
| InChI Key | MFEWNFVBWPABCX-UHFFFAOYSA-N |
| Synonym | benzopinacol, benzopinacole, benzopinacone, benzpinacol, benzpinacone, tetraphenylethylene glycol, tetraphenyl-1,2-ethanediol, benzophenone pinacol, 1,1,2,2-tetraphenyl-1,2-ethanediol, 1,2-ethanediol, 1,1,2,2-tetraphenyl |
| PubChem CID | 94766 |
| IUPAC Name | 1,1,2,2-tetraphenylethane-1,2-diol |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C(C3=CC=CC=C3)(C4=CC=CC=C4)O)O |
Chemical Identifiers
| 464-72-2 | |
| 366.46 | |
| MFEWNFVBWPABCX-UHFFFAOYSA-N | |
| 94766 | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)(C(C3=CC=CC=C3)(C4=CC=CC=C4)O)O |
| C26H22O2 | |
| MFCD00004448 | |
| benzopinacol, benzopinacole, benzopinacone, benzpinacol, benzpinacone, tetraphenylethylene glycol, tetraphenyl-1,2-ethanediol, benzophenone pinacol, 1,1,2,2-tetraphenyl-1,2-ethanediol, 1,2-ethanediol, 1,1,2,2-tetraphenyl | |
| 1,1,2,2-tetraphenylethane-1,2-diol |
Specifications
| 464-72-2 | |
| White | |
| MFCD00004448 | |
| 3077 | |
| MFEWNFVBWPABCX-UHFFFAOYSA-N | |
| 1,1,2,2-tetraphenylethane-1,2-diol | |
| 94766 | |
| ≥95.0% (HPLC) | |
| Benzopinacol |
| 181°C | |
| C26H22O2 | |
| 5 g | |
| benzopinacol, benzopinacole, benzopinacone, benzpinacol, benzpinacone, tetraphenylethylene glycol, tetraphenyl-1,2-ethanediol, benzophenone pinacol, 1,1,2,2-tetraphenyl-1,2-ethanediol, 1,2-ethanediol, 1,1,2,2-tetraphenyl | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)(C(C3=CC=CC=C3)(C4=CC=CC=C4)O)O | |
| 366.46 | |
| 366.46 | |
| Crystalline Powder |
Safety and Handling
RTECSNumber : KI2750000
TSCA : Yes