missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Benzyl Phenyl Ketone 98.0+%, TCI America™
Supplier: TCI America B043525G
Specifications
| Benzyl Phenyl Ketone | |
| 56°C | |
| 322°C | |
| MFCD00003081 | |
| 2-phenylacetophenone, deoxybenzoin, benzyl phenyl ketone, ethanone, 1,2-diphenyl, desoxybenzoin, 1,2-diphenylethan-1-one, phenyl benzyl ketone, benzoin, deoxy, acetophenone, 2-phenyl, deoxy benzoin | |
| O=C(CC1=CC=CC=C1)C1=CC=CC=C1 | |
| 196.25 | |
| 196.25 | |
| Crystalline Powder |
| 451-40-1 | |
| White-Yellow | |
| C14H12O | |
| 25 g | |
| OTKCEEWUXHVZQI-UHFFFAOYSA-N | |
| 1,2-diphenylethan-1-one | |
| 9948 | |
| ≥98.0% (GC) |
Chemical Identifiers
| 451-40-1 | |
| 196.25 | |
| OTKCEEWUXHVZQI-UHFFFAOYSA-N | |
| 9948 | |
| O=C(CC1=CC=CC=C1)C1=CC=CC=C1 |
| C14H12O | |
| MFCD00003081 | |
| 2-phenylacetophenone, deoxybenzoin, benzyl phenyl ketone, ethanone, 1,2-diphenyl, desoxybenzoin, 1,2-diphenylethan-1-one, phenyl benzyl ketone, benzoin, deoxy, acetophenone, 2-phenyl, deoxy benzoin | |
| 1,2-diphenylethan-1-one |
Safety and Handling
EINECSNumber : (4)-1893
RTECSNumber : AM9662500
TSCA : Yes
Recommended Storage : Refrigerator