missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Bis(2,4,6-trichlorophenyl) Oxalate 98.0+%, TCI America™
[Chemiluminescence reagent for the determination of fluorescent compounds]
$105.54 - $292.38
Chemical Identifiers
| CAS | 1165-91-9 |
|---|---|
| Molecular Formula | C14H4Cl6O4 |
| Molecular Weight (g/mol) | 448.882 |
| MDL Number | MFCD00043061 |
| InChI Key | GEVPIWPYWJZSPR-UHFFFAOYSA-N |
| Synonym | bis 2,4,6-trichlorophenyl oxalate, bis 2,4,6-trichlorophenyl ethanedioate, oxalic acid bis 2,4,6-trichlorophenyl ester, 2,4,6-trichlorophenyl oxalate, ethanedioic acid, bis 2,4,6-trichlorophenyl ester, bis-tcpo, acmc-20a7jt, gevpiwpywjzspr-uhfffaoysa |
| PubChem CID | 160567 |
| IUPAC Name | bis(2,4,6-trichlorophenyl) oxalate |
| SMILES | C1=C(C=C(C(=C1Cl)OC(=O)C(=O)OC2=C(C=C(C=C2Cl)Cl)Cl)Cl)Cl |
Chemical Identifiers
| 1165-91-9 | |
| 448.882 | |
| GEVPIWPYWJZSPR-UHFFFAOYSA-N | |
| 160567 | |
| C1=C(C=C(C(=C1Cl)OC(=O)C(=O)OC2=C(C=C(C=C2Cl)Cl)Cl)Cl)Cl |
| C14H4Cl6O4 | |
| MFCD00043061 | |
| bis 2,4,6-trichlorophenyl oxalate, bis 2,4,6-trichlorophenyl ethanedioate, oxalic acid bis 2,4,6-trichlorophenyl ester, 2,4,6-trichlorophenyl oxalate, ethanedioic acid, bis 2,4,6-trichlorophenyl ester, bis-tcpo, acmc-20a7jt, gevpiwpywjzspr-uhfffaoysa | |
| bis(2,4,6-trichlorophenyl) oxalate |
Specifications
| 1165-91-9 | |
| White | |
| MFCD00043061 | |
| bis 2,4,6-trichlorophenyl oxalate, bis 2,4,6-trichlorophenyl ethanedioate, oxalic acid bis 2,4,6-trichlorophenyl ester, 2,4,6-trichlorophenyl oxalate, ethanedioic acid, bis 2,4,6-trichlorophenyl ester, bis-tcpo, acmc-20a7jt, gevpiwpywjzspr-uhfffaoysa | |
| C1=C(C=C(C(=C1Cl)OC(=O)C(=O)OC2=C(C=C(C=C2Cl)Cl)Cl)Cl)Cl | |
| 448.882 | |
| 448.88 | |
| Crystalline Powder |
| 190°C | |
| C14H4Cl6O4 | |
| 1 g | |
| GEVPIWPYWJZSPR-UHFFFAOYSA-N | |
| bis(2,4,6-trichlorophenyl) oxalate | |
| 160567 | |
| ≥98.0% (T) | |
| Bis(2,4,6-trichlorophenyl) Oxalate [Chemiluminescence reagent for the determination of fluorescent c |
Safety and Handling
TSCA : No