missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Bis(4-aminophenyl) Sulfone 98.0+%, TCI America™
Supplier: TCI America D0089100G
Specifications
| Bis(4-aminophenyl) Sulfone | |
| 177°C | |
| MFCD00007887 | |
| 3077 | |
| MQJKPEGWNLWLTK-UHFFFAOYSA-N | |
| 4-(4-aminophenyl)sulfonylaniline | |
| 2955 | |
| 248.30 | |
| Crystalline Powder |
| 80-08-0 | |
| C12H12N2O2S | |
| 100 g | |
| dapsone, diaphenylsulfone, 4,4'-diaminodiphenyl sulfone, dapson, 4,4'-sulfonyldianiline, diaphenylsulfon, sulfona, 4-aminophenyl sulfone, avlosulfone, diphenasone | |
| C1=CC(=CC=C1N)S(=O)(=O)C2=CC=C(C=C2)N | |
| 248.3 | |
| CHEBI:4325 | |
| ≥98.0% (HPLC,T) |
Chemical Identifiers
| 80-08-0 | |
| 248.3 | |
| MQJKPEGWNLWLTK-UHFFFAOYSA-N | |
| 2955 | |
| 4-(4-aminophenyl)sulfonylaniline |
| C12H12N2O2S | |
| MFCD00007887 | |
| dapsone, diaphenylsulfone, 4,4'-diaminodiphenyl sulfone, dapson, 4,4'-sulfonyldianiline, diaphenylsulfon, sulfona, 4-aminophenyl sulfone, avlosulfone, diphenasone | |
| CHEBI:4325 | |
| C1=CC(=CC=C1N)S(=O)(=O)C2=CC=C(C=C2)N |
Safety and Handling
EINECSNumber : (3)-2163
RTECSNumber : BY8925000
TSCA : Yes