missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Bis(4-aminophenyl) Sulfone 98.0+%, TCI America™
$44.67 - $237.11
Chemical Identifiers
| CAS | 80-08-0 |
|---|---|
| Molecular Formula | C12H12N2O2S |
| Molecular Weight (g/mol) | 248.3 |
| MDL Number | MFCD00007887 |
| InChI Key | MQJKPEGWNLWLTK-UHFFFAOYSA-N |
| Synonym | dapsone, diaphenylsulfone, 4,4'-diaminodiphenyl sulfone, dapson, 4,4'-sulfonyldianiline, diaphenylsulfon, sulfona, 4-aminophenyl sulfone, avlosulfone, diphenasone |
| PubChem CID | 2955 |
| ChEBI | CHEBI:4325 |
| IUPAC Name | 4-(4-aminophenyl)sulfonylaniline |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)C2=CC=C(C=C2)N |
Chemical Identifiers
| 80-08-0 | |
| 248.3 | |
| MQJKPEGWNLWLTK-UHFFFAOYSA-N | |
| 2955 | |
| 4-(4-aminophenyl)sulfonylaniline |
| C12H12N2O2S | |
| MFCD00007887 | |
| dapsone, diaphenylsulfone, 4,4'-diaminodiphenyl sulfone, dapson, 4,4'-sulfonyldianiline, diaphenylsulfon, sulfona, 4-aminophenyl sulfone, avlosulfone, diphenasone | |
| CHEBI:4325 | |
| C1=CC(=CC=C1N)S(=O)(=O)C2=CC=C(C=C2)N |
Specifications
| 80-08-0 | |
| C12H12N2O2S | |
| 25 g | |
| dapsone, diaphenylsulfone, 4,4'-diaminodiphenyl sulfone, dapson, 4,4'-sulfonyldianiline, diaphenylsulfon, sulfona, 4-aminophenyl sulfone, avlosulfone, diphenasone | |
| C1=CC(=CC=C1N)S(=O)(=O)C2=CC=C(C=C2)N | |
| 248.3 | |
| CHEBI:4325 | |
| ≥98.0% (HPLC,T) | |
| Bis(4-aminophenyl) Sulfone |
| 177°C | |
| MFCD00007887 | |
| 3077 | |
| MQJKPEGWNLWLTK-UHFFFAOYSA-N | |
| 4-(4-aminophenyl)sulfonylaniline | |
| 2955 | |
| 248.30 | |
| Crystalline Powder |
Safety and Handling
EINECSNumber : (3)-2163
RTECSNumber : BY8925000
TSCA : Yes